| General Information | |
|---|---|
| ZINC ID | ZINC000084740412 |
| Molecular Weight (Da) | 445 |
| SMILES | CCCCCn1cc(CC(=O)NC23CC4CC(CC(C4)C2)C3)c2cc(-c3ccco3)ccc21 |
| Molecular Formula | C29N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.447 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| LogP | 5.959 |
| Activity (Ki) in nM | 1659.59 |
| Polar Surface Area (PSA) | 47.17 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03617465 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.55 |
| Ilogp | 4.63 |
| Xlogp3 | 6.34 |
| Wlogp | 6.72 |
| Mlogp | 4.09 |
| Silicos-it log p | 6.18 |
| Consensus log p | 5.59 |
| Esol log s | -6.31 |
| Esol solubility (mg/ml) | 0.000217 |
| Esol solubility (mol/l) | 0.00000048 |
| Esol class | Poorly sol |
| Ali log s | -7.12 |
| Ali solubility (mg/ml) | 0.0000337 |
| Ali solubility (mol/l) | 7.57E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.55 |
| Silicos-it solubility (mg/ml) | 0.00000126 |
| Silicos-it solubility (mol/l) | 2.84E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.51 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.88 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.841 |
| Logd | 5.498 |
| Logp | 6.658 |
| F (20%) | 0.022 |
| F (30%) | 0.048 |
| Mdck | - |
| Ppb | 97.63% |
| Vdss | 2.118 |
| Fu | 1.03% |
| Cyp1a2-inh | 0.132 |
| Cyp1a2-sub | 0.165 |
| Cyp2c19-inh | 0.704 |
| Cyp2c19-sub | 0.07 |
| Cl | 5.826 |
| T12 | 0.03 |
| H-ht | 0.323 |
| Dili | 0.275 |
| Roa | 0.966 |
| Fdamdd | 0.633 |
| Skinsen | 0.067 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.761 |
| Bcf | 3.059 |
| Igc50 | 5.09 |
| Lc50 | 6.394 |
| Lc50dm | 6.526 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.894 |
| Nr-aromatase | 0.012 |
| Nr-er | 0.396 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.036 |
| Sr-are | 0.719 |
| Sr-atad5 | 0.063 |
| Sr-hse | 0.899 |
| Sr-mmp | 0.745 |
| Sr-p53 | 0.668 |
| Vol | 479.92 |
| Dense | 0.926 |
| Flex | 0.321 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 4 |
| Qed | 0.392 |
| Synth | 3.783 |
| Fsp3 | 0.552 |
| Mce-18 | 75.778 |
| Natural product-likeness | -1.17 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |