| General Information | |
|---|---|
| ZINC ID | ZINC000084758859 |
| Molecular Weight (Da) | 568 |
| SMILES | Cc1c(C(=O)N2CCC(C(N)=O)(c3ccccc3)CC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C29Cl3N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 152.039 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| LogP | 6.747 |
| Activity (Ki) in nM | 5495.409 |
| Polar Surface Area (PSA) | 81.22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.978 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.21 |
| Ilogp | 4.27 |
| Xlogp3 | 6.45 |
| Wlogp | 6.09 |
| Mlogp | 4.95 |
| Silicos-it log p | 6.18 |
| Consensus log p | 5.59 |
| Esol log s | -7.48 |
| Esol solubility (mg/ml) | 0.000019 |
| Esol solubility (mol/l) | 3.34E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.95 |
| Ali solubility (mg/ml) | 0.00000637 |
| Ali solubility (mol/l) | 1.12E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.19 |
| Silicos-it solubility (mg/ml) | 3.69E-08 |
| Silicos-it solubility (mol/l) | 6.50E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.18 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.367 |
| Logd | 4.339 |
| Logp | 5.325 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | 6.82E-06 |
| Ppb | 0.9785 |
| Vdss | 0.617 |
| Fu | 0.0275 |
| Cyp1a2-inh | 0.137 |
| Cyp1a2-sub | 0.888 |
| Cyp2c19-inh | 0.873 |
| Cyp2c19-sub | 0.357 |
| Cl | 4.328 |
| T12 | 0.017 |
| H-ht | 0.343 |
| Dili | 0.923 |
| Roa | 0.785 |
| Fdamdd | 0.784 |
| Skinsen | 0.038 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.036 |
| Bcf | 2.648 |
| Igc50 | 4.867 |
| Lc50 | 5.834 |
| Lc50dm | 5.583 |
| Nr-ar | 0.058 |
| Nr-ar-lbd | 0.093 |
| Nr-ahr | 0.674 |
| Nr-aromatase | 0.704 |
| Nr-er | 0.769 |
| Nr-er-lbd | 0.379 |
| Nr-ppar-gamma | 0.521 |
| Sr-are | 0.882 |
| Sr-atad5 | 0.043 |
| Sr-hse | 0.011 |
| Sr-mmp | 0.842 |
| Sr-p53 | 0.923 |
| Vol | 540.284 |
| Dense | 1.048 |
| Flex | 0.194 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.3 |
| Synth | 2.636 |
| Fsp3 | 0.207 |
| Mce-18 | 70.857 |
| Natural product-likeness | -1.212 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |