| General Information | |
|---|---|
| ZINC ID | ZINC000095554469 |
| Molecular Weight (Da) | 427 |
| SMILES | CCCCCn1cc(C(=O)N[C@@H](C)C23CC4CC(CC(C4)C2)C3)c(=O)cc1C(C)(C)C |
| Molecular Formula | C27N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.074 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| LogP | 6.454 |
| Activity (Ki) in nM | 8.913 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75389671 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.78 |
| Ilogp | 4.23 |
| Xlogp3 | 7.13 |
| Wlogp | 5.67 |
| Mlogp | 3.97 |
| Silicos-it log p | 5.88 |
| Consensus log p | 5.38 |
| Esol log s | -6.53 |
| Esol solubility (mg/ml) | 0.000127 |
| Esol solubility (mol/l) | 0.00000029 |
| Esol class | Poorly sol |
| Ali log s | -8.02 |
| Ali solubility (mg/ml) | 0.00000405 |
| Ali solubility (mol/l) | 9.48E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.72 |
| Silicos-it solubility (mg/ml) | 0.0000807 |
| Silicos-it solubility (mol/l) | 0.00000018 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.84 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.86 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.516 |
| Logd | 4.572 |
| Logp | 6.193 |
| F (20%) | 0.394 |
| F (30%) | 0.801 |
| Mdck | 1.21E-05 |
| Ppb | 0.9396 |
| Vdss | 0.844 |
| Fu | 0.0319 |
| Cyp1a2-inh | 0.09 |
| Cyp1a2-sub | 0.77 |
| Cyp2c19-inh | 0.765 |
| Cyp2c19-sub | 0.239 |
| Cl | 2.999 |
| T12 | 0.019 |
| H-ht | 0.513 |
| Dili | 0.23 |
| Roa | 0.102 |
| Fdamdd | 0.869 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.69 |
| Bcf | 3.26 |
| Igc50 | 4.843 |
| Lc50 | 5.915 |
| Lc50dm | 6.543 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.018 |
| Nr-aromatase | 0.965 |
| Nr-er | 0.191 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.06 |
| Sr-are | 0.688 |
| Sr-atad5 | 0.001 |
| Sr-hse | 0.736 |
| Sr-mmp | 0.917 |
| Sr-p53 | 0.573 |
| Vol | 470.35 |
| Dense | 0.906 |
| Flex | 0.45 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.571 |
| Synth | 4.43 |
| Fsp3 | 0.778 |
| Mce-18 | 92.25 |
| Natural product-likeness | -0.532 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |