| General Information | |
|---|---|
| ZINC ID | ZINC000095555596 |
| Molecular Weight (Da) | 433 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c(-c2ccccc2)c1C |
| Molecular Formula | C28N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.829 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 5.717 |
| Activity (Ki) in nM | 190.546 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.08888316 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.57 |
| Ilogp | 4.46 |
| Xlogp3 | 6.24 |
| Wlogp | 5.71 |
| Mlogp | 3.93 |
| Silicos-it log p | 5.98 |
| Consensus log p | 5.26 |
| Esol log s | -6.2 |
| Esol solubility (mg/ml) | 2.71E-04 |
| Esol solubility (mol/l) | 6.27E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.1 |
| Ali solubility (mg/ml) | 3.44E-05 |
| Ali solubility (mol/l) | 7.95E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.98 |
| Silicos-it solubility (mg/ml) | 4.57E-06 |
| Silicos-it solubility (mol/l) | 1.06E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.51 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.483 |
| Logd | 4.725 |
| Logp | 5.417 |
| F (20%) | 0.002 |
| F (30%) | 0.008 |
| Mdck | 2.50E-05 |
| Ppb | 0.9488 |
| Vdss | 0.866 |
| Fu | 0.018 |
| Cyp1a2-inh | 0.153 |
| Cyp1a2-sub | 0.165 |
| Cyp2c19-inh | 0.686 |
| Cyp2c19-sub | 0.09 |
| Cl | 1.83 |
| T12 | 0.012 |
| H-ht | 0.493 |
| Dili | 0.321 |
| Roa | 0.051 |
| Fdamdd | 0.444 |
| Skinsen | 0.071 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.405 |
| Bcf | 2.371 |
| Igc50 | 4.891 |
| Lc50 | 5.967 |
| Lc50dm | 6.363 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.265 |
| Nr-aromatase | 0.094 |
| Nr-er | 0.269 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.039 |
| Sr-are | 0.631 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.878 |
| Sr-mmp | 0.605 |
| Sr-p53 | 0.823 |
| Vol | 471.181 |
| Dense | 0.917 |
| Flex | 26 |
| Nstereo | 0.308 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.57 |
| Fsp3 | 3.727 |
| Mce-18 | 0.571 |
| Natural product-likeness | 68.727 |
| Alarm nmr | -0.733 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |