| General Information | |
|---|---|
| ZINC ID | ZINC000095555825 |
| Molecular Weight (Da) | 434 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c(-c2ccncc2)c1C |
| Molecular Formula | C27N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.672 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 4.566 |
| Activity (Ki) in nM | 36.308 |
| Polar Surface Area (PSA) | 63.99 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96601003 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.59 |
| Ilogp | 3.7 |
| Xlogp3 | 5.17 |
| Wlogp | 5.11 |
| Mlogp | 2.9 |
| Silicos-it log p | 5.4 |
| Consensus log p | 4.46 |
| Esol log s | -5.53 |
| Esol solubility (mg/ml) | 1.27E-03 |
| Esol solubility (mol/l) | 2.92E-06 |
| Esol class | Moderately |
| Ali log s | -6.26 |
| Ali solubility (mg/ml) | 2.38E-04 |
| Ali solubility (mol/l) | 5.50E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.6 |
| Silicos-it solubility (mg/ml) | 1.08E-05 |
| Silicos-it solubility (mol/l) | 2.50E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.27 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.17 |
| Logd | 3.88 |
| Logp | 4.465 |
| F (20%) | 0.002 |
| F (30%) | 0.01 |
| Mdck | 2.36E-05 |
| Ppb | 0.8158 |
| Vdss | 1.291 |
| Fu | 0.128 |
| Cyp1a2-inh | 0.29 |
| Cyp1a2-sub | 0.146 |
| Cyp2c19-inh | 0.86 |
| Cyp2c19-sub | 0.068 |
| Cl | 1.823 |
| T12 | 0.025 |
| H-ht | 0.498 |
| Dili | 0.505 |
| Roa | 0.08 |
| Fdamdd | 0.774 |
| Skinsen | 0.262 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.115 |
| Bcf | 2.175 |
| Igc50 | 4.561 |
| Lc50 | 5.958 |
| Lc50dm | 6.327 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.575 |
| Nr-aromatase | 0.84 |
| Nr-er | 0.204 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.052 |
| Sr-are | 0.667 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.906 |
| Sr-mmp | 0.485 |
| Sr-p53 | 0.853 |
| Vol | 464.881 |
| Dense | 0.932 |
| Flex | 26 |
| Nstereo | 0.308 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.617 |
| Fsp3 | 3.872 |
| Mce-18 | 0.593 |
| Natural product-likeness | 69.023 |
| Alarm nmr | -0.82 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |