| General Information | |
|---|---|
| ZINC ID | ZINC000095556007 |
| Molecular Weight (Da) | 356 |
| SMILES | CC[C@H]1COc2cccc3c(=O)c(C(=O)N[C@H](C)CCC(C)C)cn1c23 |
| Molecular Formula | C21N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 99.659 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 4.443 |
| Activity (Ki) in nM | 15.849 |
| Polar Surface Area (PSA) | 60.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.78934478 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.52 |
| Ilogp | 3.07 |
| Xlogp3 | 4.92 |
| Wlogp | 3.9 |
| Mlogp | 2.22 |
| Silicos-it log p | 4.06 |
| Consensus log p | 3.63 |
| Esol log s | -4.97 |
| Esol solubility (mg/ml) | 3.80E-03 |
| Esol solubility (mol/l) | 1.07E-05 |
| Esol class | Moderately |
| Ali log s | -5.92 |
| Ali solubility (mg/ml) | 4.25E-04 |
| Ali solubility (mol/l) | 1.19E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -5.66 |
| Silicos-it solubility (mg/ml) | 7.80E-04 |
| Silicos-it solubility (mol/l) | 2.19E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.98 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.99 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.698 |
| Logd | 3.647 |
| Logp | 4.633 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 1.87E-05 |
| Ppb | 0.9171 |
| Vdss | 1.009 |
| Fu | 0.0608 |
| Cyp1a2-inh | 0.413 |
| Cyp1a2-sub | 0.734 |
| Cyp2c19-inh | 0.79 |
| Cyp2c19-sub | 0.604 |
| Cl | 2.79 |
| T12 | 0.089 |
| H-ht | 0.966 |
| Dili | 0.84 |
| Roa | 0.16 |
| Fdamdd | 0.886 |
| Skinsen | 0.479 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.278 |
| Bcf | 1.529 |
| Igc50 | 4.246 |
| Lc50 | 5.073 |
| Lc50dm | 4.945 |
| Nr-ar | 0.386 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.347 |
| Nr-aromatase | 0.223 |
| Nr-er | 0.314 |
| Nr-er-lbd | 0.029 |
| Nr-ppar-gamma | 0.019 |
| Sr-are | 0.426 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.024 |
| Sr-mmp | 0.34 |
| Sr-p53 | 0.264 |
| Vol | 378.648 |
| Dense | 0.941 |
| Flex | 17 |
| Nstereo | 0.412 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 2 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.854 |
| Fsp3 | 3.328 |
| Mce-18 | 0.524 |
| Natural product-likeness | 59.375 |
| Alarm nmr | -0.433 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |