| General Information | |
|---|---|
| ZINC ID | ZINC000095556067 |
| Molecular Weight (Da) | 354 |
| SMILES | CC[C@H]1COc2cccc3c(=O)c(C(=O)NC4CCCCCC4)cn1c23 |
| Molecular Formula | C21N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 97.833 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| LogP | 4.343 |
| Activity (Ki) in nM | 9.333 |
| Polar Surface Area (PSA) | 60.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.81415456 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.52 |
| Ilogp | 3.73 |
| Xlogp3 | 4.24 |
| Wlogp | 3.8 |
| Mlogp | 2.22 |
| Silicos-it log p | 3.49 |
| Consensus log p | 3.5 |
| Esol log s | -4.73 |
| Esol solubility (mg/ml) | 0.00661 |
| Esol solubility (mol/l) | 0.0000186 |
| Esol class | Moderately |
| Ali log s | -5.22 |
| Ali solubility (mg/ml) | 0.00215 |
| Ali solubility (mol/l) | 0.00000605 |
| Ali class | Moderately |
| Silicos-it logsw | -5.31 |
| Silicos-it solubility (mg/ml) | 0.00174 |
| Silicos-it solubility (mol/l) | 0.00000491 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.45 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.66 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.006 |
| Logd | 3.034 |
| Logp | 4.253 |
| F (20%) | 0.095 |
| F (30%) | 0.01 |
| Mdck | 2.37E-05 |
| Ppb | 0.95 |
| Vdss | 1.497 |
| Fu | 0.0404 |
| Cyp1a2-inh | 0.516 |
| Cyp1a2-sub | 0.578 |
| Cyp2c19-inh | 0.766 |
| Cyp2c19-sub | 0.362 |
| Cl | 2.656 |
| T12 | 0.07 |
| H-ht | 0.846 |
| Dili | 0.621 |
| Roa | 0.626 |
| Fdamdd | 0.922 |
| Skinsen | 0.774 |
| Ec | 0.003 |
| Ei | 0.021 |
| Respiratory | 0.578 |
| Bcf | 1.078 |
| Igc50 | 4.589 |
| Lc50 | 4.151 |
| Lc50dm | 5.497 |
| Nr-ar | 0.091 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.741 |
| Nr-aromatase | 0.883 |
| Nr-er | 0.282 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.605 |
| Sr-are | 0.575 |
| Sr-atad5 | 0.05 |
| Sr-hse | 0.255 |
| Sr-mmp | 0.49 |
| Sr-p53 | 0.752 |
| Vol | 370.092 |
| Dense | 0.957 |
| Flex | 0.167 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.853 |
| Synth | 2.946 |
| Fsp3 | 0.524 |
| Mce-18 | 74.812 |
| Natural product-likeness | -0.567 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |