| General Information | |
|---|---|
| ZINC ID | ZINC000095558977 |
| Molecular Weight (Da) | 386 |
| SMILES | Cc1ccccc1C(=O)Nc1sc2c(c1C(=O)N1CCOCC1)CCOC2 |
| Molecular Formula | C20N2O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.708 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| LogP | 2.136 |
| Activity (Ki) in nM | 7413.1 |
| Polar Surface Area (PSA) | 96.11 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.96677255 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.4 |
| Ilogp | 3.1 |
| Xlogp3 | 2.49 |
| Wlogp | 2.13 |
| Mlogp | 1.59 |
| Silicos-it log p | 4.34 |
| Consensus log p | 2.73 |
| Esol log s | -3.78 |
| Esol solubility (mg/ml) | 0.0647 |
| Esol solubility (mol/l) | 0.000167 |
| Esol class | Soluble |
| Ali log s | -4.15 |
| Ali solubility (mg/ml) | 0.0271 |
| Ali solubility (mol/l) | 0.0000702 |
| Ali class | Moderately |
| Silicos-it logsw | -5.21 |
| Silicos-it solubility (mg/ml) | 0.00238 |
| Silicos-it solubility (mol/l) | 0.00000617 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.89 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.081 |
| Logd | 2.79 |
| Logp | 2.367 |
| F (20%) | 0.112 |
| F (30%) | 0.401 |
| Mdck | - |
| Ppb | 94.79% |
| Vdss | 0.922 |
| Fu | 5.20% |
| Cyp1a2-inh | 0.555 |
| Cyp1a2-sub | 0.258 |
| Cyp2c19-inh | 0.656 |
| Cyp2c19-sub | 0.64 |
| Cl | 3.449 |
| T12 | 0.132 |
| H-ht | 0.92 |
| Dili | 0.944 |
| Roa | 0.72 |
| Fdamdd | 0.018 |
| Skinsen | 0.264 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.036 |
| Bcf | 0.722 |
| Igc50 | 2.647 |
| Lc50 | 3.042 |
| Lc50dm | 3.939 |
| Nr-ar | 0.03 |
| Nr-ar-lbd | 0.488 |
| Nr-ahr | 0.916 |
| Nr-aromatase | 0.161 |
| Nr-er | 0.547 |
| Nr-er-lbd | 0.629 |
| Nr-ppar-gamma | 0.96 |
| Sr-are | 0.37 |
| Sr-atad5 | 0.125 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.29 |
| Sr-p53 | 0.328 |
| Vol | 377.459 |
| Dense | 1.023 |
| Flex | 0.208 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.881 |
| Synth | 2.385 |
| Fsp3 | 0.4 |
| Mce-18 | 52.5 |
| Natural product-likeness | -1.987 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |