| General Information | |
|---|---|
| ZINC ID | ZINC000095559143 |
| Molecular Weight (Da) | 390 |
| SMILES | CCCCCn1c(C)c(C(=O)c2ccc(Cl)c3ccccc23)c2ccccc21 |
| Molecular Formula | C25Cl1N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.127 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 7.146 |
| Activity (Ki) in nM | 8.9125 |
| Polar Surface Area (PSA) | 22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.131 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 19 |
| Fraction csp3 | 0.24 |
| Ilogp | 4.05 |
| Xlogp3 | 7.35 |
| Wlogp | 7.18 |
| Mlogp | 4.87 |
| Silicos-it log p | 7.16 |
| Consensus log p | 6.12 |
| Esol log s | -6.99 |
| Esol solubility (mg/ml) | 0.0000395 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -7.64 |
| Ali solubility (mg/ml) | 0.00000893 |
| Ali solubility (mol/l) | 2.29E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.54 |
| Silicos-it solubility (mg/ml) | 0.00000011 |
| Silicos-it solubility (mol/l) | 2.89E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.46 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.79 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.643 |
| Logd | 5.006 |
| Logp | 6.816 |
| F (20%) | 0.604 |
| F (30%) | 0.991 |
| Mdck | - |
| Ppb | 99.36% |
| Vdss | 1.356 |
| Fu | 0.55% |
| Cyp1a2-inh | 0.835 |
| Cyp1a2-sub | 0.276 |
| Cyp2c19-inh | 0.814 |
| Cyp2c19-sub | 0.069 |
| Cl | 5.182 |
| T12 | 0.004 |
| H-ht | 0.149 |
| Dili | 0.928 |
| Roa | 0.128 |
| Fdamdd | 0.908 |
| Skinsen | 0.244 |
| Ec | 0.003 |
| Ei | 0.949 |
| Respiratory | 0.131 |
| Bcf | 1.871 |
| Igc50 | 5.564 |
| Lc50 | 6.572 |
| Lc50dm | 6.795 |
| Nr-ar | 0.098 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.808 |
| Nr-aromatase | 0.842 |
| Nr-er | 0.745 |
| Nr-er-lbd | 0.798 |
| Nr-ppar-gamma | 0.017 |
| Sr-are | 0.851 |
| Sr-atad5 | 0.337 |
| Sr-hse | 0.218 |
| Sr-mmp | 0.881 |
| Sr-p53 | 0.667 |
| Vol | 415.364 |
| Dense | 0.937 |
| Flex | 0.273 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 3 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.253 |
| Synth | 2.141 |
| Fsp3 | 0.24 |
| Mce-18 | 22 |
| Natural product-likeness | -0.777 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |