| General Information | |
|---|---|
| ZINC ID | ZINC000095576036 |
| Molecular Weight (Da) | 585 |
| SMILES | NC(=O)[C@@H](N/C(=NS(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1)C1CCC1 |
| Molecular Formula | C28Cl2N5O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 151.963 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| LogP | 5.605 |
| Activity (Ki) in nM | 8.3176 |
| Polar Surface Area (PSA) | 125.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.993 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 4.08 |
| Xlogp3 | 5.63 |
| Wlogp | 5.1 |
| Mlogp | 4.04 |
| Silicos-it log p | 4.57 |
| Consensus log p | 4.68 |
| Esol log s | -6.76 |
| Esol solubility (mg/ml) | 0.000102 |
| Esol solubility (mol/l) | 0.00000017 |
| Esol class | Poorly sol |
| Ali log s | -8.03 |
| Ali solubility (mg/ml) | 0.00000544 |
| Ali solubility (mol/l) | 9.31E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.94 |
| Silicos-it solubility (mg/ml) | 0.00000067 |
| Silicos-it solubility (mol/l) | 1.15E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.87 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.103 |
| Logd | 2.561 |
| Logp | 4.892 |
| F (20%) | 0.002 |
| F (30%) | 0.015 |
| Mdck | - |
| Ppb | 99.54% |
| Vdss | 0.736 |
| Fu | 1.78% |
| Cyp1a2-inh | 0.141 |
| Cyp1a2-sub | 0.744 |
| Cyp2c19-inh | 0.885 |
| Cyp2c19-sub | 0.584 |
| Cl | 0.567 |
| T12 | 0.009 |
| H-ht | 0.908 |
| Dili | 0.987 |
| Roa | 0.743 |
| Fdamdd | 0.93 |
| Skinsen | 0.028 |
| Ec | 0.003 |
| Ei | 0.004 |
| Respiratory | 0.501 |
| Bcf | 1.138 |
| Igc50 | 4.917 |
| Lc50 | 5.381 |
| Lc50dm | 5.103 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.022 |
| Nr-ahr | 0.291 |
| Nr-aromatase | 0.125 |
| Nr-er | 0.691 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.719 |
| Sr-are | 0.668 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.92 |
| Sr-p53 | 0.271 |
| Vol | 548.71 |
| Dense | 1.063 |
| Flex | 0.29 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.307 |
| Synth | 3.693 |
| Fsp3 | 0.25 |
| Mce-18 | 100.286 |
| Natural product-likeness | -0.656 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |