| General Information | |
|---|---|
| ZINC ID | ZINC000095578876 |
| Molecular Weight (Da) | 587 |
| SMILES | CC(C)(C)[C@H](N/C(=NS(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1)C(N)=O |
| Molecular Formula | C28Cl2N5O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 153.563 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| LogP | 5.794 |
| Activity (Ki) in nM | 1.9953 |
| Polar Surface Area (PSA) | 125.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.965 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 4.19 |
| Xlogp3 | 6.06 |
| Wlogp | 5.35 |
| Mlogp | 4.04 |
| Silicos-it log p | 4.81 |
| Consensus log p | 4.89 |
| Esol log s | -7.04 |
| Esol solubility (mg/ml) | 0.0000533 |
| Esol solubility (mol/l) | 9.08E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.48 |
| Ali solubility (mg/ml) | 0.00000195 |
| Ali solubility (mol/l) | 3.33E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.27 |
| Silicos-it solubility (mg/ml) | 0.00000031 |
| Silicos-it solubility (mol/l) | 5.41E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.58 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.31 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.394 |
| Logd | 2.718 |
| Logp | 5.097 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.65% |
| Vdss | 0.676 |
| Fu | 1.66% |
| Cyp1a2-inh | 0.097 |
| Cyp1a2-sub | 0.754 |
| Cyp2c19-inh | 0.813 |
| Cyp2c19-sub | 0.86 |
| Cl | 0.674 |
| T12 | 0.011 |
| H-ht | 0.803 |
| Dili | 0.985 |
| Roa | 0.282 |
| Fdamdd | 0.927 |
| Skinsen | 0.041 |
| Ec | 0.003 |
| Ei | 0.004 |
| Respiratory | 0.452 |
| Bcf | 1.021 |
| Igc50 | 5.089 |
| Lc50 | 5.831 |
| Lc50dm | 5.413 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.023 |
| Nr-ahr | 0.332 |
| Nr-aromatase | 0.156 |
| Nr-er | 0.79 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.695 |
| Sr-are | 0.625 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.007 |
| Sr-mmp | 0.927 |
| Sr-p53 | 0.224 |
| Vol | 557.266 |
| Dense | 1.05 |
| Flex | 0.333 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.311 |
| Synth | 3.699 |
| Fsp3 | 0.25 |
| Mce-18 | 90.314 |
| Natural product-likeness | -0.68 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |