| General Information | |
|---|---|
| ZINC ID | ZINC000095579153 |
| Molecular Weight (Da) | 338 |
| SMILES | CCCCCc1cc(O)c2cc(Cc3ccccc3O)c(=O)oc2c1 |
| Molecular Formula | C21O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.291 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| LogP | 5.762 |
| Activity (Ki) in nM | 4786.301 |
| Polar Surface Area (PSA) | 70.67 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.11480629 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.29 |
| Ilogp | 3.14 |
| Xlogp3 | 5.55 |
| Wlogp | 4.53 |
| Mlogp | 3.3 |
| Silicos-it log p | 5.41 |
| Consensus log p | 4.39 |
| Esol log s | -5.51 |
| Esol solubility (mg/ml) | 0.00104 |
| Esol solubility (mol/l) | 0.00000307 |
| Esol class | Moderately |
| Ali log s | -6.79 |
| Ali solubility (mg/ml) | 0.0000543 |
| Ali solubility (mol/l) | 0.00000016 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.36 |
| Silicos-it solubility (mg/ml) | 0.0000149 |
| Silicos-it solubility (mol/l) | 0.00000004 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.42 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.66 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.69 |
| Logd | 4.11 |
| Logp | 5.06 |
| F (20%) | 0.995 |
| F (30%) | 0.998 |
| Mdck | 1.94E-05 |
| Ppb | 0.9998 |
| Vdss | 0.428 |
| Fu | 0.0068 |
| Cyp1a2-inh | 0.91 |
| Cyp1a2-sub | 0.658 |
| Cyp2c19-inh | 0.962 |
| Cyp2c19-sub | 0.072 |
| Cl | 6.081 |
| T12 | 0.622 |
| H-ht | 0.288 |
| Dili | 0.912 |
| Roa | 0.633 |
| Fdamdd | 0.684 |
| Skinsen | 0.923 |
| Ec | 0.004 |
| Ei | 0.927 |
| Respiratory | 0.061 |
| Bcf | 1.783 |
| Igc50 | 5.308 |
| Lc50 | 5.603 |
| Lc50dm | 5.508 |
| Nr-ar | 0.065 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.842 |
| Nr-aromatase | 0.835 |
| Nr-er | 0.795 |
| Nr-er-lbd | 0.729 |
| Nr-ppar-gamma | 0.981 |
| Sr-are | 0.876 |
| Sr-atad5 | 0.096 |
| Sr-hse | 0.658 |
| Sr-mmp | 0.967 |
| Sr-p53 | 0.862 |
| Vol | 360.172 |
| Dense | 0.939 |
| Flex | 0.333 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.512 |
| Synth | 2.4 |
| Fsp3 | 0.286 |
| Mce-18 | 17 |
| Natural product-likeness | 0.844 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |