| General Information | |
|---|---|
| ZINC ID | ZINC000095579430 |
| Molecular Weight (Da) | 370 |
| SMILES | CCn1cc(C(=O)N[C@@H]2C(C)(C)[C@H]3CC[C@]2(C)C3)c(=O)c2ccc(F)cc21 |
| Molecular Formula | C22F1N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 100.645 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| LogP | 4.348 |
| Activity (Ki) in nM | 7.244 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.76627481 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.55 |
| Ilogp | 3.07 |
| Xlogp3 | 4.62 |
| Wlogp | 4.53 |
| Mlogp | 3.38 |
| Silicos-it log p | 4.52 |
| Consensus log p | 4.02 |
| Esol log s | -5.06 |
| Esol solubility (mg/ml) | 0.00324 |
| Esol solubility (mol/l) | 0.00000876 |
| Esol class | Moderately |
| Ali log s | -5.42 |
| Ali solubility (mg/ml) | 0.00141 |
| Ali solubility (mol/l) | 0.00000382 |
| Ali class | Moderately |
| Silicos-it logsw | -6.42 |
| Silicos-it solubility (mg/ml) | 0.000142 |
| Silicos-it solubility (mol/l) | 0.00000038 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.28 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.53 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.15 |
| Logd | 3.806 |
| Logp | 5.027 |
| F (20%) | 0.004 |
| F (30%) | 0.036 |
| Mdck | 1.72E-05 |
| Ppb | 0.7918 |
| Vdss | 0.824 |
| Fu | 0.169 |
| Cyp1a2-inh | 0.375 |
| Cyp1a2-sub | 0.72 |
| Cyp2c19-inh | 0.822 |
| Cyp2c19-sub | 0.434 |
| Cl | 2.482 |
| T12 | 0.04 |
| H-ht | 0.481 |
| Dili | 0.252 |
| Roa | 0.326 |
| Fdamdd | 0.971 |
| Skinsen | 0.37 |
| Ec | 0.004 |
| Ei | 0.017 |
| Respiratory | 0.909 |
| Bcf | 1.537 |
| Igc50 | 4.529 |
| Lc50 | 5.538 |
| Lc50dm | 6.959 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.112 |
| Nr-aromatase | 0.922 |
| Nr-er | 0.099 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.663 |
| Sr-are | 0.456 |
| Sr-atad5 | 0.015 |
| Sr-hse | 0.591 |
| Sr-mmp | 0.703 |
| Sr-p53 | 0.718 |
| Vol | 384.665 |
| Dense | 0.962 |
| Flex | 0.19 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.884 |
| Synth | 4.268 |
| Fsp3 | 0.545 |
| Mce-18 | 92.118 |
| Natural product-likeness | -0.176 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |