| General Information | |
|---|---|
| ZINC ID | ZINC000095580440 |
| Molecular Weight (Da) | 530 |
| SMILES | NC(=O)CN/C(=NS(=O)(=O)c1ccc(Cl)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| Molecular Formula | C24Cl2N5O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 135.675 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| LogP | 4.194 |
| Activity (Ki) in nM | 5011.872 |
| Polar Surface Area (PSA) | 125.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.945 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.12 |
| Ilogp | 3.42 |
| Xlogp3 | 4.3 |
| Wlogp | 3.94 |
| Mlogp | 3.25 |
| Silicos-it log p | 3.68 |
| Consensus log p | 3.72 |
| Esol log s | -5.69 |
| Esol solubility (mg/ml) | 0.00108 |
| Esol solubility (mol/l) | 0.00000204 |
| Esol class | Moderately |
| Ali log s | -6.65 |
| Ali solubility (mg/ml) | 0.000118 |
| Ali solubility (mol/l) | 0.00000022 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.48 |
| Silicos-it solubility (mg/ml) | 0.00000174 |
| Silicos-it solubility (mol/l) | 3.29E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.48 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.61 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.92 |
| Logd | 1.828 |
| Logp | 3.589 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | 2.28E-05 |
| Ppb | 0.9868 |
| Vdss | 0.584 |
| Fu | 0.0261 |
| Cyp1a2-inh | 0.274 |
| Cyp1a2-sub | 0.731 |
| Cyp2c19-inh | 0.863 |
| Cyp2c19-sub | 0.495 |
| Cl | 0.459 |
| T12 | 0.051 |
| H-ht | 0.66 |
| Dili | 0.987 |
| Roa | 0.15 |
| Fdamdd | 0.509 |
| Skinsen | 0.052 |
| Ec | 0.003 |
| Ei | 0.004 |
| Respiratory | 0.275 |
| Bcf | 0.554 |
| Igc50 | 4.399 |
| Lc50 | 4.094 |
| Lc50dm | 4.777 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.035 |
| Nr-ahr | 0.178 |
| Nr-aromatase | 0.008 |
| Nr-er | 0.546 |
| Nr-er-lbd | 0.026 |
| Nr-ppar-gamma | 0.128 |
| Sr-are | 0.211 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.005 |
| Sr-mmp | 0.724 |
| Sr-p53 | 0.045 |
| Vol | 488.082 |
| Dense | 1.084 |
| Flex | 0.296 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.374 |
| Synth | 3.209 |
| Fsp3 | 0.125 |
| Mce-18 | 78.704 |
| Natural product-likeness | -0.714 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |