| General Information | |
|---|---|
| ZINC ID | ZINC000095582734 |
| Molecular Weight (Da) | 483 |
| SMILES | CCN(CC)c1ccc(CN(C23CC4CC(CC(C4)C2)C3)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| Molecular Formula | C28N2O3S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 138.625 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| LogP | 5.517 |
| Activity (Ki) in nM | 7244.36 |
| Polar Surface Area (PSA) | 58.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.75285834 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.57 |
| Ilogp | 4.07 |
| Xlogp3 | 6.07 |
| Wlogp | 6.63 |
| Mlogp | 4.04 |
| Silicos-it log p | 4.08 |
| Consensus log p | 4.98 |
| Esol log s | -6.32 |
| Esol solubility (mg/ml) | 0.000229 |
| Esol solubility (mol/l) | 0.00000047 |
| Esol class | Poorly sol |
| Ali log s | -7.07 |
| Ali solubility (mg/ml) | 0.0000408 |
| Ali solubility (mol/l) | 8.46E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.54 |
| Silicos-it solubility (mg/ml) | 0.0000141 |
| Silicos-it solubility (mol/l) | 2.92E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.93 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 4 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.67 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.192 |
| Logd | 4.856 |
| Logp | 6.289 |
| F (20%) | 0.002 |
| F (30%) | 0.006 |
| Mdck | - |
| Ppb | 97.95% |
| Vdss | 0.968 |
| Fu | 0.60% |
| Cyp1a2-inh | 0.094 |
| Cyp1a2-sub | 0.69 |
| Cyp2c19-inh | 0.809 |
| Cyp2c19-sub | 0.342 |
| Cl | 9.282 |
| T12 | 0.016 |
| H-ht | 0.855 |
| Dili | 0.958 |
| Roa | 0.075 |
| Fdamdd | 0.342 |
| Skinsen | 0.016 |
| Ec | 0.003 |
| Ei | 0.023 |
| Respiratory | 0.939 |
| Bcf | 2.381 |
| Igc50 | 5.058 |
| Lc50 | 5.977 |
| Lc50dm | 6.921 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.016 |
| Nr-ahr | 0.174 |
| Nr-aromatase | 0.981 |
| Nr-er | 0.34 |
| Nr-er-lbd | 0.113 |
| Nr-ppar-gamma | 0.01 |
| Sr-are | 0.865 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.865 |
| Sr-mmp | 0.875 |
| Sr-p53 | 0.045 |
| Vol | 501.116 |
| Dense | 0.962 |
| Flex | 0.346 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.46 |
| Synth | 3.785 |
| Fsp3 | 0.571 |
| Mce-18 | 73.636 |
| Natural product-likeness | -0.896 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |