| General Information | |
|---|---|
| ZINC ID | ZINC000095586633 |
| Molecular Weight (Da) | 441 |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(Cc1ccc(N2CCCCC2)cc1)c1ccccc1 |
| Molecular Formula | C24Cl1N2O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.774 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| LogP | 5.851 |
| Activity (Ki) in nM | 141.254 |
| Polar Surface Area (PSA) | 49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.15278923 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.32 |
| Xlogp3 | 5.72 |
| Wlogp | 6.27 |
| Mlogp | 4.32 |
| Silicos-it log p | 4.08 |
| Consensus log p | 4.74 |
| Esol log s | -6.23 |
| Esol solubility (mg/ml) | 2.62E-04 |
| Esol solubility (mol/l) | 5.95E-07 |
| Esol class | Poorly sol |
| Ali log s | -6.52 |
| Ali solubility (mg/ml) | 1.34E-04 |
| Ali solubility (mol/l) | 3.05E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.32 |
| Silicos-it solubility (mg/ml) | 2.10E-06 |
| Silicos-it solubility (mol/l) | 4.76E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.93 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.04 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.133 |
| Logd | 4.383 |
| Logp | 6.104 |
| F (20%) | 0.714 |
| F (30%) | 0.082 |
| Mdck | 8.36E-06 |
| Ppb | 0.9945 |
| Vdss | 0.754 |
| Fu | 0.005 |
| Cyp1a2-inh | 0.184 |
| Cyp1a2-sub | 0.351 |
| Cyp2c19-inh | 0.872 |
| Cyp2c19-sub | 0.103 |
| Cl | 3.601 |
| T12 | 0.039 |
| H-ht | 0.666 |
| Dili | 0.985 |
| Roa | 0.629 |
| Fdamdd | 0.116 |
| Skinsen | 0.076 |
| Ec | 0.003 |
| Ei | 0.044 |
| Respiratory | 0.092 |
| Bcf | 1.658 |
| Igc50 | 5.041 |
| Lc50 | 5.644 |
| Lc50dm | 5.73 |
| Nr-ar | 0.097 |
| Nr-ar-lbd | 0.086 |
| Nr-ahr | 0.218 |
| Nr-aromatase | 0.726 |
| Nr-er | 0.639 |
| Nr-er-lbd | 0.081 |
| Nr-ppar-gamma | 0.293 |
| Sr-are | 0.888 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.042 |
| Sr-mmp | 0.911 |
| Sr-p53 | 0.252 |
| Vol | 439 |
| Dense | 1.003 |
| Flex | 26 |
| Nstereo | 0.231 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.491 |
| Fsp3 | 1.972 |
| Mce-18 | 0.25 |
| Natural product-likeness | 51.333 |
| Alarm nmr | -1.786 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |