| General Information | |
|---|---|
| ZINC ID | ZINC000095586713 |
| Molecular Weight (Da) | 464 |
| SMILES | Cc1c(/C(F)=CC2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C24Cl3F1N2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.382 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 9.009 |
| Activity (Ki) in nM | 3981.072 |
| Polar Surface Area (PSA) | 17.82 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.21336948 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 4.71 |
| Xlogp3 | 8.91 |
| Wlogp | 9.12 |
| Mlogp | 6.66 |
| Silicos-it log p | 7.77 |
| Consensus log p | 7.44 |
| Esol log s | -8.48 |
| Esol solubility (mg/ml) | 0.00000152 |
| Esol solubility (mol/l) | 3.28E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.17 |
| Ali solubility (mg/ml) | 0.00000031 |
| Ali solubility (mol/l) | 6.74E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.35 |
| Silicos-it solubility (mg/ml) | 0.0000002 |
| Silicos-it solubility (mol/l) | 4.51E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.8 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.7 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.784 |
| Logd | 5.621 |
| Logp | 7.978 |
| F (20%) | 0.001 |
| F (30%) | 0.004 |
| Mdck | 5.19E-06 |
| Ppb | 0.9914 |
| Vdss | 3.694 |
| Fu | 0.0107 |
| Cyp1a2-inh | 0.149 |
| Cyp1a2-sub | 0.539 |
| Cyp2c19-inh | 0.788 |
| Cyp2c19-sub | 0.131 |
| Cl | 4.885 |
| T12 | 0.008 |
| H-ht | 0.075 |
| Dili | 0.962 |
| Roa | 0.295 |
| Fdamdd | 0.836 |
| Skinsen | 0.046 |
| Ec | 0.003 |
| Ei | 0.213 |
| Respiratory | 0.01 |
| Bcf | 3.57 |
| Igc50 | 5.646 |
| Lc50 | 6.935 |
| Lc50dm | 6.395 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.047 |
| Nr-ahr | 0.436 |
| Nr-aromatase | 0.805 |
| Nr-er | 0.729 |
| Nr-er-lbd | 0.359 |
| Nr-ppar-gamma | 0.032 |
| Sr-are | 0.925 |
| Sr-atad5 | 0.062 |
| Sr-hse | 0.51 |
| Sr-mmp | 0.942 |
| Sr-p53 | 0.967 |
| Vol | 439.4 |
| Dense | 1.052 |
| Flex | 0.167 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.378 |
| Synth | 2.698 |
| Fsp3 | 0.292 |
| Mce-18 | 54.903 |
| Natural product-likeness | -0.951 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |