| General Information | |
|---|---|
| ZINC ID | ZINC000095586857 |
| Molecular Weight (Da) | 349 |
| SMILES | O=C(N1CCc2ccc(C(F)(F)F)cc21)C12CC3CC(CC(C3)C1)C2 |
| Molecular Formula | C20F3N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 88.989 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| LogP | 4.856 |
| Activity (Ki) in nM | 2.884 |
| Polar Surface Area (PSA) | 20.31 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.66916245 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.35 |
| Xlogp3 | 4.78 |
| Wlogp | 5.58 |
| Mlogp | 4.91 |
| Silicos-it log p | 4.68 |
| Consensus log p | 4.66 |
| Esol log s | -5 |
| Esol solubility (mg/ml) | 3.52E-03 |
| Esol solubility (mol/l) | 1.01E-05 |
| Esol class | Moderately |
| Ali log s | -4.94 |
| Ali solubility (mg/ml) | 4.03E-03 |
| Ali solubility (mol/l) | 1.15E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.15 |
| Silicos-it solubility (mg/ml) | 2.50E-03 |
| Silicos-it solubility (mol/l) | 7.14E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.04 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.68 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.265 |
| Logd | 4.555 |
| Logp | 5.495 |
| F (20%) | 0.002 |
| F (30%) | 0.014 |
| Mdck | 1.48E-05 |
| Ppb | 0.9501 |
| Vdss | 1.459 |
| Fu | 0.017 |
| Cyp1a2-inh | 0.155 |
| Cyp1a2-sub | 0.813 |
| Cyp2c19-inh | 0.663 |
| Cyp2c19-sub | 0.81 |
| Cl | 2.962 |
| T12 | 0.011 |
| H-ht | 0.524 |
| Dili | 0.068 |
| Roa | 0.584 |
| Fdamdd | 0.15 |
| Skinsen | 0.035 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.718 |
| Bcf | 3.304 |
| Igc50 | 4.264 |
| Lc50 | 5.278 |
| Lc50dm | 6.424 |
| Nr-ar | 0.063 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.545 |
| Nr-aromatase | 0.808 |
| Nr-er | 0.391 |
| Nr-er-lbd | 0.142 |
| Nr-ppar-gamma | 0.068 |
| Sr-are | 0.82 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.252 |
| Sr-mmp | 0.771 |
| Sr-p53 | 0.875 |
| Vol | 339.138 |
| Dense | 1.03 |
| Flex | 23 |
| Nstereo | 0.13 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 3 |
| Synth | 0.712 |
| Fsp3 | 3.665 |
| Mce-18 | 0.65 |
| Natural product-likeness | 79.091 |
| Alarm nmr | -1.048 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |