| General Information | |
|---|---|
| ZINC ID | ZINC000095588722 |
| Molecular Weight (Da) | 427 |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(F)cc2)cc1 |
| Molecular Formula | C24F1N2O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.376 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| LogP | 5.179 |
| Activity (Ki) in nM | 102.329 |
| Polar Surface Area (PSA) | 49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.00934183 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.62 |
| Xlogp3 | 5.01 |
| Wlogp | 6.26 |
| Mlogp | 4.34 |
| Silicos-it log p | 4.18 |
| Consensus log p | 4.68 |
| Esol log s | -5.49 |
| Esol solubility (mg/ml) | 0.00138 |
| Esol solubility (mol/l) | 0.00000323 |
| Esol class | Moderately |
| Ali log s | -5.78 |
| Ali solubility (mg/ml) | 0.000709 |
| Ali solubility (mol/l) | 0.00000166 |
| Ali class | Moderately |
| Silicos-it logsw | -8.6 |
| Silicos-it solubility (mg/ml) | 0.00000107 |
| Silicos-it solubility (mol/l) | 2.51E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.34 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.02 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.529 |
| Logd | 4.487 |
| Logp | 5.326 |
| F (20%) | 0.003 |
| F (30%) | 0.015 |
| Mdck | 2.20E-05 |
| Ppb | 0.9938 |
| Vdss | 0.54 |
| Fu | 0.0111 |
| Cyp1a2-inh | 0.478 |
| Cyp1a2-sub | 0.719 |
| Cyp2c19-inh | 0.917 |
| Cyp2c19-sub | 0.075 |
| Cl | 11.786 |
| T12 | 0.034 |
| H-ht | 0.771 |
| Dili | 0.986 |
| Roa | 0.153 |
| Fdamdd | 0.419 |
| Skinsen | 0.034 |
| Ec | 0.003 |
| Ei | 0.262 |
| Respiratory | 0.614 |
| Bcf | 2.346 |
| Igc50 | 4.949 |
| Lc50 | 5.807 |
| Lc50dm | 7.089 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.021 |
| Nr-ahr | 0.269 |
| Nr-aromatase | 0.979 |
| Nr-er | 0.474 |
| Nr-er-lbd | 0.051 |
| Nr-ppar-gamma | 0.039 |
| Sr-are | 0.798 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.146 |
| Sr-mmp | 0.868 |
| Sr-p53 | 0.023 |
| Vol | 438.413 |
| Dense | 0.972 |
| Flex | 0.45 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.48 |
| Synth | 2.024 |
| Fsp3 | 0.25 |
| Mce-18 | 19 |
| Natural product-likeness | -1.616 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |