| General Information | |
|---|---|
| ZINC ID | ZINC000095589282 |
| Molecular Weight (Da) | 429 |
| SMILES | CCN(CC)c1ccc(CN(Cc2cccs2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| Molecular Formula | C23N2O2S2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.916 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| LogP | 4.972 |
| Activity (Ki) in nM | 14.125 |
| Polar Surface Area (PSA) | 77.24 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.00970792 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.3 |
| Ilogp | 3.82 |
| Xlogp3 | 5 |
| Wlogp | 6.07 |
| Mlogp | 3.4 |
| Silicos-it log p | 4.9 |
| Consensus log p | 4.64 |
| Esol log s | -5.49 |
| Esol solubility (mg/ml) | 0.0014 |
| Esol solubility (mol/l) | 0.00000326 |
| Esol class | Moderately |
| Ali log s | -6.36 |
| Ali solubility (mg/ml) | 0.000186 |
| Ali solubility (mol/l) | 0.00000043 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.97 |
| Silicos-it solubility (mg/ml) | 0.00000454 |
| Silicos-it solubility (mol/l) | 1.06E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.36 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 2 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.3 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.659 |
| Logd | 4.507 |
| Logp | 5.528 |
| F (20%) | 0.027 |
| F (30%) | 0.083 |
| Mdck | 2.01E-05 |
| Ppb | 0.9953 |
| Vdss | 0.676 |
| Fu | 0.0074 |
| Cyp1a2-inh | 0.59 |
| Cyp1a2-sub | 0.922 |
| Cyp2c19-inh | 0.916 |
| Cyp2c19-sub | 0.126 |
| Cl | 11.16 |
| T12 | 0.04 |
| H-ht | 0.812 |
| Dili | 0.985 |
| Roa | 0.143 |
| Fdamdd | 0.076 |
| Skinsen | 0.034 |
| Ec | 0.004 |
| Ei | 0.311 |
| Respiratory | 0.427 |
| Bcf | 1.986 |
| Igc50 | 4.852 |
| Lc50 | 6.039 |
| Lc50dm | 6.169 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.226 |
| Nr-aromatase | 0.976 |
| Nr-er | 0.805 |
| Nr-er-lbd | 0.195 |
| Nr-ppar-gamma | 0.077 |
| Sr-are | 0.861 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.597 |
| Sr-mmp | 0.906 |
| Sr-p53 | 0.053 |
| Vol | 436.195 |
| Dense | 0.982 |
| Flex | 0.474 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.465 |
| Synth | 2.194 |
| Fsp3 | 0.304 |
| Mce-18 | 19 |
| Natural product-likeness | -2.116 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |