| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095592721 |
| Molecular Weight (Da) | 339 |
| SMILES | CCO[C@H]1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| Molecular Formula | C22N1O2 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095592721 |
| Molecular Weight (Da) | 339 |
| SMILES | CCO[C@H]1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| Molecular Formula | C22N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095592721 |
| Molar Refractivity | 98.663 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| LogP | 3.774 |
| Activity (Ki) in nM | 5011.87 |
| Polar Surface Area (PSA) | 29.54 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095592721 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | + |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.80353212 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.68 |
| Ilogp | 3.63 |
| Xlogp3 | 4.04 |
| Wlogp | 4.01 |
| Mlogp | 3.87 |
| Silicos-it log p | 3.9 |
| Consensus log p | 3.89 |
| Esol log s | -4.4 |
| Esol solubility (mg/ml) | 0.0134 |
| Esol solubility (mol/l) | 0.0000395 |
| Esol class | Moderately |
| Ali log s | -4.36 |
| Ali solubility (mg/ml) | 0.0147 |
| Ali solubility (mol/l) | 0.0000433 |
| Ali class | Moderately |
| Silicos-it logsw | -4.85 |
| Silicos-it solubility (mg/ml) | 0.00483 |
| Silicos-it solubility (mol/l) | 0.0000142 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.5 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 5.14 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.287 |
| Logd | 4.123 |
| Logp | 4.894 |
| F (20%) | 0.003 |
| F (30%) | 0.024 |
| Mdck | - |
| Ppb | 73.41% |
| Vdss | 1.411 |
| Fu | 11.52% |
| Cyp1a2-inh | 0.062 |
| Cyp1a2-sub | 0.778 |
| Cyp2c19-inh | 0.758 |
| Cyp2c19-sub | 0.905 |
| Cl | 3.451 |
| T12 | 0.02 |
| H-ht | 0.49 |
| Dili | 0.21 |
| Roa | 0.677 |
| Fdamdd | 0.681 |
| Skinsen | 0.131 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.428 |
| Bcf | 3.368 |
| Igc50 | 4.309 |
| Lc50 | 5.439 |
| Lc50dm | 6.254 |
| Nr-ar | 0.015 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.59 |
| Nr-aromatase | 0.845 |
| Nr-er | 0.328 |
| Nr-er-lbd | 0.033 |
| Nr-ppar-gamma | 0.053 |
| Sr-are | 0.631 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.265 |
| Sr-mmp | 0.832 |
| Sr-p53 | 0.608 |
| Vol | 364.317 |
| Dense | 0.931 |
| Flex | 0.167 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.797 |
| Synth | 4.199 |
| Fsp3 | 0.682 |
| Mce-18 | 96.27 |
| Natural product-likeness | -0.377 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |