| General Information | |
|---|---|
| ZINC ID | ZINC000095594094 |
| Molecular Weight (Da) | 345 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCC2)c(=O)c2c(C)noc21 |
| Molecular Formula | C19N3O3 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 93.899 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| LogP | 3.982 |
| Activity (Ki) in nM | 8.71 |
| Polar Surface Area (PSA) | 77.13 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.83172577 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.63 |
| Ilogp | 3.44 |
| Xlogp3 | 3.97 |
| Wlogp | 3.55 |
| Mlogp | 2.21 |
| Silicos-it log p | 3.65 |
| Consensus log p | 3.36 |
| Esol log s | -4.29 |
| Esol solubility (mg/ml) | 0.0178 |
| Esol solubility (mol/l) | 0.0000516 |
| Esol class | Moderately |
| Ali log s | -5.29 |
| Ali solubility (mg/ml) | 0.00177 |
| Ali solubility (mol/l) | 0.00000512 |
| Ali class | Moderately |
| Silicos-it logsw | -5.42 |
| Silicos-it solubility (mg/ml) | 0.00132 |
| Silicos-it solubility (mol/l) | 0.00000382 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.59 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.57 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.958 |
| Logd | 3.235 |
| Logp | 3.843 |
| F (20%) | 0.002 |
| F (30%) | 0.007 |
| Mdck | 2.36E-05 |
| Ppb | 0.941 |
| Vdss | 1.205 |
| Fu | 0.0485 |
| Cyp1a2-inh | 0.529 |
| Cyp1a2-sub | 0.704 |
| Cyp2c19-inh | 0.662 |
| Cyp2c19-sub | 0.3 |
| Cl | 2.446 |
| T12 | 0.081 |
| H-ht | 0.966 |
| Dili | 0.977 |
| Roa | 0.061 |
| Fdamdd | 0.185 |
| Skinsen | 0.31 |
| Ec | 0.003 |
| Ei | 0.021 |
| Respiratory | 0.846 |
| Bcf | 1.181 |
| Igc50 | 4.196 |
| Lc50 | 4.506 |
| Lc50dm | 4.753 |
| Nr-ar | 0.035 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.852 |
| Nr-aromatase | 0.035 |
| Nr-er | 0.19 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.84 |
| Sr-are | 0.542 |
| Sr-atad5 | 0.042 |
| Sr-hse | 0.092 |
| Sr-mmp | 0.201 |
| Sr-p53 | 0.693 |
| Vol | 357.689 |
| Dense | 0.965 |
| Flex | 0.389 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.812 |
| Synth | 2.654 |
| Fsp3 | 0.632 |
| Mce-18 | 40.581 |
| Natural product-likeness | -1.184 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |