| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095596350 |
| Molecular Weight (Da) | 465 |
| SMILES | O=C(NCC1CCC1)c1nc(OCCOCCO)ccc1NC(=O)c1ccnc2ccccc12 |
| Molecular Formula | C25N4O5 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095596350 |
| Molecular Weight (Da) | 465 |
| SMILES | O=C(NCC1CCC1)c1nc(OCCOCCO)ccc1NC(=O)c1ccnc2ccccc12 |
| Molecular Formula | C25N4O5 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095596350 |
| Molar Refractivity | 124.838 |
| HBA | 7 |
| HBD | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| LogP | 2.418 |
| Activity (Ki) in nM | 1202.264 |
| Polar Surface Area (PSA) | 122.67 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095596350 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.822 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.36 |
| Ilogp | 2.59 |
| Xlogp3 | 2.88 |
| Wlogp | 2.61 |
| Mlogp | 1.02 |
| Silicos-it log p | 3.44 |
| Consensus log p | 2.51 |
| Esol log s | -4.02 |
| Esol solubility (mg/ml) | 0.0439 |
| Esol solubility (mol/l) | 0.0000945 |
| Esol class | Moderately |
| Ali log s | -5.12 |
| Ali solubility (mg/ml) | 0.00356 |
| Ali solubility (mol/l) | 0.00000766 |
| Ali class | Moderately |
| Silicos-it logsw | -7.51 |
| Silicos-it solubility (mg/ml) | 0.0000142 |
| Silicos-it solubility (mol/l) | 3.05E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.09 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.7 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.24 |
| Logd | 2.914 |
| Logp | 3.196 |
| F (20%) | 0.987 |
| F (30%) | 0.973 |
| Mdck | 1.91E-05 |
| Ppb | 0.9457 |
| Vdss | 1.129 |
| Fu | 0.0581 |
| Cyp1a2-inh | 0.262 |
| Cyp1a2-sub | 0.057 |
| Cyp2c19-inh | 0.416 |
| Cyp2c19-sub | 0.068 |
| Cl | 3.278 |
| T12 | 0.246 |
| H-ht | 0.918 |
| Dili | 0.946 |
| Roa | 0.64 |
| Fdamdd | 0.044 |
| Skinsen | 0.071 |
| Ec | 0.003 |
| Ei | 0.023 |
| Respiratory | 0.264 |
| Bcf | 0.877 |
| Igc50 | 3.409 |
| Lc50 | 4.267 |
| Lc50dm | 5.02 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.939 |
| Nr-aromatase | 0.905 |
| Nr-er | 0.244 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.71 |
| Sr-are | 0.722 |
| Sr-atad5 | 0.3 |
| Sr-hse | 0.661 |
| Sr-mmp | 0.662 |
| Sr-p53 | 0.866 |
| Vol | 468.304 |
| Dense | 0.991 |
| Flex | 0.565 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.373 |
| Synth | 2.532 |
| Fsp3 | 0.36 |
| Mce-18 | 46.941 |
| Natural product-likeness | -1.221 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |