| General Information | |
|---|---|
| ZINC ID | ZINC000095597322 |
| Molecular Weight (Da) | 455 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCC2)c(=O)c2c(-c3ccc(Cl)cc3)nn(C)c21 |
| Molecular Formula | C25Cl1N4O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.035 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 5.863 |
| Activity (Ki) in nM | 3630.781 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.047248 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.48 |
| Ilogp | 3.99 |
| Xlogp3 | 5.72 |
| Wlogp | 5.31 |
| Mlogp | 3.76 |
| Silicos-it log p | 5 |
| Consensus log p | 4.76 |
| Esol log s | -6.08 |
| Esol solubility (mg/ml) | 3.75E-04 |
| Esol solubility (mol/l) | 8.25E-07 |
| Esol class | Poorly sol |
| Ali log s | -6.93 |
| Ali solubility (mg/ml) | 5.29E-05 |
| Ali solubility (mol/l) | 1.16E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.63 |
| Silicos-it solubility (mg/ml) | 1.07E-05 |
| Silicos-it solubility (mol/l) | 2.35E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.01 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.689 |
| Logd | 4.1 |
| Logp | 5.593 |
| F (20%) | 0.004 |
| F (30%) | 0.01 |
| Mdck | 1.95E-05 |
| Ppb | 0.9788 |
| Vdss | 1.979 |
| Fu | 0.0205 |
| Cyp1a2-inh | 0.362 |
| Cyp1a2-sub | 0.362 |
| Cyp2c19-inh | 0.702 |
| Cyp2c19-sub | 0.096 |
| Cl | 5.698 |
| T12 | 0.017 |
| H-ht | 0.554 |
| Dili | 0.824 |
| Roa | 0.137 |
| Fdamdd | 0.781 |
| Skinsen | 0.111 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.378 |
| Bcf | 1.21 |
| Igc50 | 4.915 |
| Lc50 | 4.958 |
| Lc50dm | 5.506 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.38 |
| Nr-aromatase | 0.919 |
| Nr-er | 0.33 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.946 |
| Sr-are | 0.809 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.699 |
| Sr-mmp | 0.819 |
| Sr-p53 | 0.929 |
| Vol | 462.417 |
| Dense | 0.982 |
| Flex | 24 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0 |
| Synth | 0.492 |
| Fsp3 | 2.61 |
| Mce-18 | 0.48 |
| Natural product-likeness | 53.459 |
| Alarm nmr | -1.203 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |