| General Information | |
|---|---|
| ZINC ID | ZINC000095604502 |
| Molecular Weight (Da) | 397 |
| SMILES | CC1(C)Oc2cc(C34CC5CC(CC(C5)C3)C4)cc(O)c2[C@@H]2C[C@@H](CO)CC[C@H]21 |
| Molecular Formula | C26O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.71 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| LogP | 5.275 |
| Activity (Ki) in nM | 64.565 |
| Polar Surface Area (PSA) | 49.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.629 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.77 |
| Ilogp | 3.99 |
| Xlogp3 | 6.06 |
| Wlogp | 5.52 |
| Mlogp | 4.66 |
| Silicos-it log p | 4.99 |
| Consensus log p | 5.05 |
| Esol log s | -6.14 |
| Esol solubility (mg/ml) | 0.000289 |
| Esol solubility (mol/l) | 0.00000072 |
| Esol class | Poorly sol |
| Ali log s | -6.88 |
| Ali solubility (mg/ml) | 0.0000519 |
| Ali solubility (mol/l) | 0.00000013 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.39 |
| Silicos-it solubility (mg/ml) | 0.0016 |
| Silicos-it solubility (mol/l) | 0.00000404 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.42 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 6.13 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.097 |
| Logd | 5.213 |
| Logp | 7.151 |
| F (20%) | 0.074 |
| F (30%) | 0.354 |
| Mdck | 2.11E-05 |
| Ppb | 0.9432 |
| Vdss | 1.875 |
| Fu | 0.0128 |
| Cyp1a2-inh | 0.071 |
| Cyp1a2-sub | 0.754 |
| Cyp2c19-inh | 0.585 |
| Cyp2c19-sub | 0.484 |
| Cl | 4.232 |
| T12 | 0.072 |
| H-ht | 0.819 |
| Dili | 0.026 |
| Roa | 0.092 |
| Fdamdd | 0.842 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.051 |
| Respiratory | 0.844 |
| Bcf | 3.293 |
| Igc50 | 5.107 |
| Lc50 | 6.267 |
| Lc50dm | 6.214 |
| Nr-ar | 0.007 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.785 |
| Nr-aromatase | 0.902 |
| Nr-er | 0.354 |
| Nr-er-lbd | 0.137 |
| Nr-ppar-gamma | 0.234 |
| Sr-are | 0.666 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.855 |
| Sr-mmp | 0.958 |
| Sr-p53 | 0.861 |
| Vol | 425.375 |
| Dense | 0.932 |
| Flex | 0.071 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 2 |
| Qed | 0.692 |
| Synth | 5.01 |
| Fsp3 | 0.769 |
| Mce-18 | 127.13 |
| Natural product-likeness | 1.501 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Rejected |