| General Information | |
|---|---|
| ZINC ID | ZINC000095604503 |
| Molecular Weight (Da) | 395 |
| SMILES | CC1(C)Oc2cc(C34CC5CC(CC(C5)C3)C4)cc(O)c2[C@@H]2CC(CO)=CC[C@H]21 |
| Molecular Formula | C26O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 115.483 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| LogP | 5.092 |
| Activity (Ki) in nM | 10.715 |
| Polar Surface Area (PSA) | 49.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.735 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.69 |
| Ilogp | 3.73 |
| Xlogp3 | 6.46 |
| Wlogp | 5.44 |
| Mlogp | 4.57 |
| Silicos-it log p | 4.97 |
| Consensus log p | 5.04 |
| Esol log s | -6.38 |
| Esol solubility (mg/ml) | 0.000166 |
| Esol solubility (mol/l) | 0.00000042 |
| Esol class | Poorly sol |
| Ali log s | -7.3 |
| Ali solubility (mg/ml) | 0.0000199 |
| Ali solubility (mol/l) | 5.03E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.38 |
| Silicos-it solubility (mg/ml) | 0.00166 |
| Silicos-it solubility (mol/l) | 0.0000042 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.12 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 6.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.449 |
| Logd | 4.883 |
| Logp | 6.836 |
| F (20%) | 0.936 |
| F (30%) | 0.777 |
| Mdck | 2.10E-05 |
| Ppb | 0.9535 |
| Vdss | 2.115 |
| Fu | 0.0106 |
| Cyp1a2-inh | 0.066 |
| Cyp1a2-sub | 0.382 |
| Cyp2c19-inh | 0.726 |
| Cyp2c19-sub | 0.291 |
| Cl | 4.716 |
| T12 | 0.086 |
| H-ht | 0.769 |
| Dili | 0.035 |
| Roa | 0.234 |
| Fdamdd | 0.819 |
| Skinsen | 0.029 |
| Ec | 0.003 |
| Ei | 0.047 |
| Respiratory | 0.937 |
| Bcf | 3.242 |
| Igc50 | 5.059 |
| Lc50 | 6.396 |
| Lc50dm | 6.182 |
| Nr-ar | 0.022 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.641 |
| Nr-aromatase | 0.904 |
| Nr-er | 0.278 |
| Nr-er-lbd | 0.062 |
| Nr-ppar-gamma | 0.29 |
| Sr-are | 0.666 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.89 |
| Sr-mmp | 0.947 |
| Sr-p53 | 0.831 |
| Vol | 422.738 |
| Dense | 0.933 |
| Flex | 0.071 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.657 |
| Synth | 5.003 |
| Fsp3 | 0.692 |
| Mce-18 | 125.182 |
| Natural product-likeness | 1.787 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |