| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095605498 |
| Molecular Weight (Da) | 298 |
| SMILES | CCCCn1c(C)c(C)cc(NC(=O)c2ccccc2)c1=O |
| Molecular Formula | C18N2O2 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095605498 |
| Molecular Weight (Da) | 298 |
| SMILES | CCCCn1c(C)c(C)cc(NC(=O)c2ccccc2)c1=O |
| Molecular Formula | C18N2O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095605498 |
| Molar Refractivity | 87.853 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| LogP | 3.753 |
| Activity (Ki) in nM | 89.125 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000095605498 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.07350158 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.33 |
| Ilogp | 3.5 |
| Xlogp3 | 2.97 |
| Wlogp | 3.33 |
| Mlogp | 2.87 |
| Silicos-it log p | 3.79 |
| Consensus log p | 3.29 |
| Esol log s | -3.57 |
| Esol solubility (mg/ml) | 8.06E-02 |
| Esol solubility (mol/l) | 2.70E-04 |
| Esol class | Soluble |
| Ali log s | -3.71 |
| Ali solubility (mg/ml) | 5.87E-02 |
| Ali solubility (mol/l) | 1.97E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -5.99 |
| Silicos-it solubility (mg/ml) | 3.05E-04 |
| Silicos-it solubility (mol/l) | 1.02E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.01 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 2.66 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -4.781 |
| Logd | 3.625 |
| Logp | 3.639 |
| F (20%) | 0.007 |
| F (30%) | 0.248 |
| Mdck | 2.13E-05 |
| Ppb | 0.9194 |
| Vdss | 0.858 |
| Fu | 0.0569 |
| Cyp1a2-inh | 0.608 |
| Cyp1a2-sub | 0.935 |
| Cyp2c19-inh | 0.662 |
| Cyp2c19-sub | 0.657 |
| Cl | 3.65 |
| T12 | 0.221 |
| H-ht | 0.296 |
| Dili | 0.893 |
| Roa | 0.04 |
| Fdamdd | 0.273 |
| Skinsen | 0.343 |
| Ec | 0.003 |
| Ei | 0.233 |
| Respiratory | 0.468 |
| Bcf | 1.045 |
| Igc50 | 4.132 |
| Lc50 | 5.049 |
| Lc50dm | 4.659 |
| Nr-ar | 0.057 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.914 |
| Nr-aromatase | 0.161 |
| Nr-er | 0.208 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.032 |
| Sr-are | 0.137 |
| Sr-atad5 | 0.083 |
| Sr-hse | 0.034 |
| Sr-mmp | 0.356 |
| Sr-p53 | 0.358 |
| Vol | 323.89 |
| Dense | 0.921 |
| Flex | 14 |
| Nstereo | 0.429 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.918 |
| Fsp3 | 1.96 |
| Mce-18 | 0.333 |
| Natural product-likeness | 13 |
| Alarm nmr | -1.225 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Accepted |