| General Information | |
|---|---|
| ZINC ID | ZINC000095605919 |
| Molecular Weight (Da) | 338 |
| SMILES | CCN1C(=O)[C@H](Sc2nc3ccccc3o2)c2ccccc2[C@H]1C |
| Molecular Formula | C19N2O2S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 93.698 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| LogP | 3.858 |
| Activity (Ki) in nM | 41.687 |
| Polar Surface Area (PSA) | 71.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.14756119 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.26 |
| Ilogp | 3.09 |
| Xlogp3 | 4.17 |
| Wlogp | 3.55 |
| Mlogp | 2.89 |
| Silicos-it log p | 3.53 |
| Consensus log p | 3.45 |
| Esol log s | -4.83 |
| Esol solubility (mg/ml) | 5.01E-03 |
| Esol solubility (mol/l) | 1.48E-05 |
| Esol class | Moderately |
| Ali log s | -5.38 |
| Ali solubility (mg/ml) | 1.40E-03 |
| Ali solubility (mol/l) | 4.14E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -6.28 |
| Silicos-it solubility (mg/ml) | 1.76E-04 |
| Silicos-it solubility (mol/l) | 5.21E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.4 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.01 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.173 |
| Logd | 3.625 |
| Logp | 3.78 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | 3.39E-05 |
| Ppb | 0.9937 |
| Vdss | 0.591 |
| Fu | 0.0078 |
| Cyp1a2-inh | 0.926 |
| Cyp1a2-sub | 0.824 |
| Cyp2c19-inh | 0.971 |
| Cyp2c19-sub | 0.479 |
| Cl | 3.434 |
| T12 | 0.163 |
| H-ht | 0.787 |
| Dili | 0.989 |
| Roa | 0.03 |
| Fdamdd | 0.953 |
| Skinsen | 0.196 |
| Ec | 0.003 |
| Ei | 0.021 |
| Respiratory | 0.923 |
| Bcf | 1.616 |
| Igc50 | 5.086 |
| Lc50 | 6.81 |
| Lc50dm | 5.129 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.476 |
| Nr-aromatase | 0.953 |
| Nr-er | 0.169 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.246 |
| Sr-are | 0.889 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.007 |
| Sr-mmp | 0.412 |
| Sr-p53 | 0.025 |
| Vol | 339.946 |
| Dense | 0.995 |
| Flex | 22 |
| Nstereo | 0.136 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.701 |
| Fsp3 | 3.462 |
| Mce-18 | 0.263 |
| Natural product-likeness | 66.5 |
| Alarm nmr | -0.719 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Accepted |