| General Information | |
|---|---|
| ZINC ID | ZINC000096908236 |
| Molecular Weight (Da) | 489 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCCC2)c(=O)n2nc(-c3ccc(Cl)cc3Cl)cc12 |
| Molecular Formula | C25Cl2N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.753 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| LogP | 6.786 |
| Activity (Ki) in nM | 37.154 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.11360824 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.48 |
| Ilogp | 4.05 |
| Xlogp3 | 7 |
| Wlogp | 6.11 |
| Mlogp | 5.04 |
| Silicos-it log p | 5.31 |
| Consensus log p | 5.5 |
| Esol log s | -7.09 |
| Esol solubility (mg/ml) | 3.95E-05 |
| Esol solubility (mol/l) | 8.07E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.25 |
| Ali solubility (mg/ml) | 2.74E-06 |
| Ali solubility (mol/l) | 5.60E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.1 |
| Silicos-it solubility (mg/ml) | 3.89E-06 |
| Silicos-it solubility (mol/l) | 7.94E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.32 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.76 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.138 |
| Logd | 4.389 |
| Logp | 6.469 |
| F (20%) | 0.013 |
| F (30%) | 0.017 |
| Mdck | 1.49E-05 |
| Ppb | 0.9822 |
| Vdss | 1.739 |
| Fu | 0.0193 |
| Cyp1a2-inh | 0.294 |
| Cyp1a2-sub | 0.19 |
| Cyp2c19-inh | 0.72 |
| Cyp2c19-sub | 0.093 |
| Cl | 7.816 |
| T12 | 0.023 |
| H-ht | 0.599 |
| Dili | 0.864 |
| Roa | 0.069 |
| Fdamdd | 0.906 |
| Skinsen | 0.233 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.122 |
| Bcf | 1.552 |
| Igc50 | 5.18 |
| Lc50 | 4.902 |
| Lc50dm | 5.98 |
| Nr-ar | 0.015 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.426 |
| Nr-aromatase | 0.887 |
| Nr-er | 0.472 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.627 |
| Sr-are | 0.878 |
| Sr-atad5 | 0.035 |
| Sr-hse | 0.595 |
| Sr-mmp | 0.898 |
| Sr-p53 | 0.848 |
| Vol | 477.628 |
| Dense | 1.022 |
| Flex | 25 |
| Nstereo | 0.32 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0 |
| Synth | 0.322 |
| Fsp3 | 2.679 |
| Mce-18 | 0.48 |
| Natural product-likeness | 54.703 |
| Alarm nmr | -1.33 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |