| General Information | |
|---|---|
| ZINC ID | ZINC000096908243 |
| Molecular Weight (Da) | 358 |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCC2)c(=O)n2nc(CC)cc12 |
| Molecular Formula | C20N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.202 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| LogP | 4.004 |
| Activity (Ki) in nM | 10.471 |
| Polar Surface Area (PSA) | 68.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.82770782 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.99 |
| Xlogp3 | 4.37 |
| Wlogp | 3.31 |
| Mlogp | 3.25 |
| Silicos-it log p | 3.09 |
| Consensus log p | 3.6 |
| Esol log s | -4.54 |
| Esol solubility (mg/ml) | 0.0102 |
| Esol solubility (mol/l) | 0.0000286 |
| Esol class | Moderately |
| Ali log s | -5.52 |
| Ali solubility (mg/ml) | 0.00108 |
| Ali solubility (mol/l) | 0.000003 |
| Ali class | Moderately |
| Silicos-it logsw | -4.99 |
| Silicos-it solubility (mg/ml) | 0.00371 |
| Silicos-it solubility (mol/l) | 0.0000104 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.38 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.903 |
| Logd | 3.82 |
| Logp | 3.972 |
| F (20%) | 0.053 |
| F (30%) | 0.231 |
| Mdck | 2.77E-05 |
| Ppb | 0.765 |
| Vdss | 1.596 |
| Fu | 0.1456 |
| Cyp1a2-inh | 0.602 |
| Cyp1a2-sub | 0.501 |
| Cyp2c19-inh | 0.685 |
| Cyp2c19-sub | 0.517 |
| Cl | 8.896 |
| T12 | 0.253 |
| H-ht | 0.178 |
| Dili | 0.367 |
| Roa | 0.021 |
| Fdamdd | 0.896 |
| Skinsen | 0.147 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.082 |
| Bcf | 0.607 |
| Igc50 | 3.989 |
| Lc50 | 3.507 |
| Lc50dm | 4.427 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.05 |
| Nr-aromatase | 0.603 |
| Nr-er | 0.228 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.162 |
| Sr-are | 0.531 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.335 |
| Sr-mmp | 0.295 |
| Sr-p53 | 0.337 |
| Vol | 377.192 |
| Dense | 0.95 |
| Flex | 0.444 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.772 |
| Synth | 2.689 |
| Fsp3 | 0.65 |
| Mce-18 | 40.182 |
| Natural product-likeness | -1.181 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |