| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096911095 |
| Molecular Weight (Da) | 423 |
| SMILES | CCCCCCOc1ccccc1-c1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)no1 |
| Molecular Formula | C26N2O3 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096911095 |
| Molecular Weight (Da) | 423 |
| SMILES | CCCCCCOc1ccccc1-c1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)no1 |
| Molecular Formula | C26N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096911095 |
| Molar Refractivity | 118.239 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| LogP | 6.053 |
| Activity (Ki) in nM | 3.388 |
| Polar Surface Area (PSA) | 64.36 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096911095 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.07502281 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.62 |
| Ilogp | 4.81 |
| Xlogp3 | 6.62 |
| Wlogp | 6 |
| Mlogp | 3.9 |
| Silicos-it log p | 5.65 |
| Consensus log p | 5.4 |
| Esol log s | -6.23 |
| Esol solubility (mg/ml) | 2.47E-04 |
| Esol solubility (mol/l) | 5.85E-07 |
| Esol class | Poorly sol |
| Ali log s | -7.77 |
| Ali solubility (mg/ml) | 7.14E-06 |
| Ali solubility (mol/l) | 1.69E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.88 |
| Silicos-it solubility (mg/ml) | 5.63E-06 |
| Silicos-it solubility (mol/l) | 1.33E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.18 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 6.12 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.829 |
| Logd | 5.334 |
| Logp | 6.719 |
| F (20%) | 0.007 |
| F (30%) | 0.072 |
| Mdck | 2.17E-05 |
| Ppb | 0.9916 |
| Vdss | 1.269 |
| Fu | 0.0069 |
| Cyp1a2-inh | 0.244 |
| Cyp1a2-sub | 0.16 |
| Cyp2c19-inh | 0.847 |
| Cyp2c19-sub | 0.069 |
| Cl | 2.52 |
| T12 | 0.01 |
| H-ht | 0.679 |
| Dili | 0.769 |
| Roa | 0.142 |
| Fdamdd | 0.356 |
| Skinsen | 0.046 |
| Ec | 0.003 |
| Ei | 0.016 |
| Respiratory | 0.895 |
| Bcf | 2.842 |
| Igc50 | 5.188 |
| Lc50 | 6.349 |
| Lc50dm | 6.424 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.944 |
| Nr-aromatase | 0.037 |
| Nr-er | 0.432 |
| Nr-er-lbd | 0.002 |
| Nr-ppar-gamma | 0.044 |
| Sr-are | 0.725 |
| Sr-atad5 | 0.185 |
| Sr-hse | 0.805 |
| Sr-mmp | 0.778 |
| Sr-p53 | 0.838 |
| Vol | 448.015 |
| Dense | 0.943 |
| Flex | 24 |
| Nstereo | 0.417 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.503 |
| Fsp3 | 3.611 |
| Mce-18 | 0.615 |
| Natural product-likeness | 64.381 |
| Alarm nmr | -0.993 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |