| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096913506 |
| Molecular Weight (Da) | 387 |
| SMILES | CCCCCOc1ccccc1-c1cc(C(=O)N(CC(C)C)CC(C)C)no1 |
| Molecular Formula | C23N2O3 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096913506 |
| Molecular Weight (Da) | 387 |
| SMILES | CCCCCOc1ccccc1-c1cc(C(=O)N(CC(C)C)CC(C)C)no1 |
| Molecular Formula | C23N2O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096913506 |
| Molar Refractivity | 110.407 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| LogP | 6.043 |
| Activity (Ki) in nM | 21.878 |
| Polar Surface Area (PSA) | 55.57 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096913506 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.11312902 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.57 |
| Ilogp | 4.25 |
| Xlogp3 | 6.25 |
| Wlogp | 5.66 |
| Mlogp | 3.28 |
| Silicos-it log p | 5.5 |
| Consensus log p | 4.99 |
| Esol log s | -5.67 |
| Esol solubility (mg/ml) | 8.21E-04 |
| Esol solubility (mol/l) | 2.12E-06 |
| Esol class | Moderately |
| Ali log s | -7.2 |
| Ali solubility (mg/ml) | 2.42E-05 |
| Ali solubility (mol/l) | 6.25E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.18 |
| Silicos-it solubility (mg/ml) | 2.58E-05 |
| Silicos-it solubility (mol/l) | 6.67E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.22 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.94 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.504 |
| Logd | 5.092 |
| Logp | 6.05 |
| F (20%) | 0.033 |
| F (30%) | 0.366 |
| Mdck | 1.18E-05 |
| Ppb | 0.9888 |
| Vdss | 1.216 |
| Fu | 0.0162 |
| Cyp1a2-inh | 0.197 |
| Cyp1a2-sub | 0.413 |
| Cyp2c19-inh | 0.871 |
| Cyp2c19-sub | 0.149 |
| Cl | 4.08 |
| T12 | 0.05 |
| H-ht | 0.386 |
| Dili | 0.972 |
| Roa | 0.061 |
| Fdamdd | 0.022 |
| Skinsen | 0.038 |
| Ec | 0.003 |
| Ei | 0.043 |
| Respiratory | 0.766 |
| Bcf | 2.549 |
| Igc50 | 5.062 |
| Lc50 | 5.961 |
| Lc50dm | 5.14 |
| Nr-ar | 0.024 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.854 |
| Nr-aromatase | 0.223 |
| Nr-er | 0.909 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.563 |
| Sr-atad5 | 0.019 |
| Sr-hse | 0.012 |
| Sr-mmp | 0.262 |
| Sr-p53 | 0.004 |
| Vol | 421.797 |
| Dense | 0.916 |
| Flex | 12 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.467 |
| Fsp3 | 2.361 |
| Mce-18 | 0.565 |
| Natural product-likeness | 14 |
| Alarm nmr | -1.235 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |