| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096937554 |
| Molecular Weight (Da) | 523 |
| SMILES | CC(C)CC(=O)NC1CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| Molecular Formula | C27Cl2N6O1 |
| Action | Antagonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096937554 |
| Molecular Weight (Da) | 523 |
| SMILES | CC(C)CC(=O)NC1CCN(c2ncnc3c2nc(-c2ccccc2Cl)n3-c2ccc(Cl)cc2)CC1 |
| Molecular Formula | C27Cl2N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096937554 |
| Molar Refractivity | 143.859 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| LogP | 5.906 |
| Activity (Ki) in nM | 89.125 |
| Polar Surface Area (PSA) | 75.94 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000096937554 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.975 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.27 |
| Xlogp3 | 6.22 |
| Wlogp | 5.54 |
| Mlogp | 4.62 |
| Silicos-it log p | 4.9 |
| Consensus log p | 5.11 |
| Esol log s | -6.97 |
| Esol solubility (mg/ml) | 0.0000556 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -7.6 |
| Ali solubility (mg/ml) | 0.0000131 |
| Ali solubility (mol/l) | 2.51E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.12 |
| Silicos-it solubility (mg/ml) | 0.00000039 |
| Silicos-it solubility (mol/l) | 7.53E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.08 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.57 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.843 |
| Logd | 4.538 |
| Logp | 5.197 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 2.79E-05 |
| Ppb | 0.9661 |
| Vdss | 1.716 |
| Fu | 0.0269 |
| Cyp1a2-inh | 0.375 |
| Cyp1a2-sub | 0.216 |
| Cyp2c19-inh | 0.914 |
| Cyp2c19-sub | 0.185 |
| Cl | 4.534 |
| T12 | 0.105 |
| H-ht | 0.872 |
| Dili | 0.963 |
| Roa | 0.929 |
| Fdamdd | 0.933 |
| Skinsen | 0.117 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.589 |
| Bcf | 1.789 |
| Igc50 | 4.42 |
| Lc50 | 5.345 |
| Lc50dm | 5.055 |
| Nr-ar | 0.03 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.856 |
| Nr-aromatase | 0.884 |
| Nr-er | 0.722 |
| Nr-er-lbd | 0.251 |
| Nr-ppar-gamma | 0.741 |
| Sr-are | 0.884 |
| Sr-atad5 | 0.725 |
| Sr-hse | 0.641 |
| Sr-mmp | 0.7 |
| Sr-p53 | 0.917 |
| Vol | 508.958 |
| Dense | 1.026 |
| Flex | 0.241 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.34 |
| Synth | 2.579 |
| Fsp3 | 0.333 |
| Mce-18 | 63.778 |
| Natural product-likeness | -1.467 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |