| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000098085523 |
| Molecular Weight (Da) | 369 |
| SMILES | CCCCCCCn1nc(C(=O)NN2CCCCC2)cc1-c1ccccc1 |
| Molecular Formula | C22N4O1 |
| Action | Antagonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000098085523 |
| Molecular Weight (Da) | 369 |
| SMILES | CCCCCCCn1nc(C(=O)NN2CCCCC2)cc1-c1ccccc1 |
| Molecular Formula | C22N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000098085523 |
| Molar Refractivity | 111.4 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| LogP | 5.323 |
| Activity (Ki) in nM | 323.594 |
| Polar Surface Area (PSA) | 50.16 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000098085523 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.16285729 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.55 |
| Ilogp | 4.01 |
| Xlogp3 | 5.39 |
| Wlogp | 4.27 |
| Mlogp | 3.61 |
| Silicos-it log p | 3.91 |
| Consensus log p | 4.24 |
| Esol log s | -5.16 |
| Esol solubility (mg/ml) | 0.00254 |
| Esol solubility (mol/l) | 0.00000689 |
| Esol class | Moderately |
| Ali log s | -6.2 |
| Ali solubility (mg/ml) | 0.000234 |
| Ali solubility (mol/l) | 0.00000063 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.42 |
| Silicos-it solubility (mg/ml) | 0.000142 |
| Silicos-it solubility (mol/l) | 0.00000038 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.72 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.34 |
| Logd | 4.606 |
| Logp | 4.921 |
| F (20%) | 0.486 |
| F (30%) | 0.017 |
| Mdck | - |
| Ppb | 96.19% |
| Vdss | 0.725 |
| Fu | 2.87% |
| Cyp1a2-inh | 0.135 |
| Cyp1a2-sub | 0.772 |
| Cyp2c19-inh | 0.632 |
| Cyp2c19-sub | 0.716 |
| Cl | 9.14 |
| T12 | 0.026 |
| H-ht | 0.399 |
| Dili | 0.778 |
| Roa | 0.835 |
| Fdamdd | 0.202 |
| Skinsen | 0.243 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.94 |
| Bcf | 0.968 |
| Igc50 | 4.88 |
| Lc50 | 5.65 |
| Lc50dm | 5.106 |
| Nr-ar | 0.017 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.472 |
| Nr-aromatase | 0.889 |
| Nr-er | 0.658 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.233 |
| Sr-are | 0.689 |
| Sr-atad5 | 0.028 |
| Sr-hse | 0.295 |
| Sr-mmp | 0.82 |
| Sr-p53 | 0.19 |
| Vol | 400.357 |
| Dense | 0.92 |
| Flex | 0.556 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.655 |
| Synth | 2.35 |
| Fsp3 | 0.545 |
| Mce-18 | 34.412 |
| Natural product-likeness | -1.246 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |