| General Information | |
|---|---|
| ZINC ID | ZINC000100919201 |
| Molecular Weight (Da) | 488 |
| SMILES | COc1cc(Cl)cc2c(C(=O)N[C@H]3C(C)(C)[C@H]4CC[C@@]3(C)C4)c(C)n(CCN3CCOCC3)c12 |
| Molecular Formula | C27Cl1N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 133.56 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| LogP | 4.535 |
| Activity (Ki) in nM | 251.189 |
| Polar Surface Area (PSA) | 55.73 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.7887088 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.67 |
| Ilogp | 0 |
| Xlogp3 | 4.84 |
| Wlogp | 4.51 |
| Mlogp | 3.25 |
| Silicos-it log p | 5.08 |
| Consensus log p | 3.54 |
| Esol log s | -5.65 |
| Esol solubility (mg/ml) | 1.09E-03 |
| Esol solubility (mol/l) | 2.24E-06 |
| Esol class | Moderately |
| Ali log s | -5.74 |
| Ali solubility (mg/ml) | 8.80E-04 |
| Ali solubility (mol/l) | 1.80E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -7.04 |
| Silicos-it solubility (mg/ml) | 4.48E-05 |
| Silicos-it solubility (mol/l) | 9.18E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.84 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.42 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.336 |
| Logd | 4.395 |
| Logp | 5.295 |
| F (20%) | 0.879 |
| F (30%) | 0.79 |
| Mdck | 1.04E-05 |
| Ppb | 0.8863 |
| Vdss | 1.664 |
| Fu | 0.072 |
| Cyp1a2-inh | 0.105 |
| Cyp1a2-sub | 0.668 |
| Cyp2c19-inh | 0.874 |
| Cyp2c19-sub | 0.907 |
| Cl | 5.909 |
| T12 | 0.029 |
| H-ht | 0.46 |
| Dili | 0.465 |
| Roa | 0.466 |
| Fdamdd | 0.921 |
| Skinsen | 0.089 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.877 |
| Bcf | 1.427 |
| Igc50 | 4.043 |
| Lc50 | 5.216 |
| Lc50dm | 6.281 |
| Nr-ar | 0.289 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.376 |
| Nr-aromatase | 0.349 |
| Nr-er | 0.163 |
| Nr-er-lbd | 0.076 |
| Nr-ppar-gamma | 0.277 |
| Sr-are | 0.203 |
| Sr-atad5 | 0.015 |
| Sr-hse | 0.227 |
| Sr-mmp | 0.305 |
| Sr-p53 | 0.745 |
| Vol | 494.156 |
| Dense | 0.986 |
| Flex | 25 |
| Nstereo | 0.28 |
| Nongenotoxic carcinogenicity | 3 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 2 |
| Synth | 0.63 |
| Fsp3 | 4.528 |
| Mce-18 | 0.667 |
| Natural product-likeness | 111.644 |
| Alarm nmr | -0.299 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |