| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000101195118 |
| Molecular Weight (Da) | 393 |
| SMILES | C[C@@H]1CC[C@@H](NC(=O)c2cc3cccnc3n(Cc3ccc(F)cc3)c2=O)CC1 |
| Molecular Formula | C23F1N3O2 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000101195118 |
| Molecular Weight (Da) | 393 |
| SMILES | C[C@@H]1CC[C@@H](NC(=O)c2cc3cccnc3n(Cc3ccc(F)cc3)c2=O)CC1 |
| Molecular Formula | C23F1N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000101195118 |
| Molar Refractivity | 110.146 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 4.623 |
| Activity (Ki) in nM | 199.526 |
| Polar Surface Area (PSA) | 63.99 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000101195118 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03249561 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.35 |
| Ilogp | 3.77 |
| Xlogp3 | 3.92 |
| Wlogp | 4.31 |
| Mlogp | 4.02 |
| Silicos-it log p | 4.18 |
| Consensus log p | 4.04 |
| Esol log s | -4.83 |
| Esol solubility (mg/ml) | 0.00586 |
| Esol solubility (mol/l) | 0.0000149 |
| Esol class | Moderately |
| Ali log s | -4.96 |
| Ali solubility (mg/ml) | 0.00429 |
| Ali solubility (mol/l) | 0.0000109 |
| Ali class | Moderately |
| Silicos-it logsw | -7.13 |
| Silicos-it solubility (mg/ml) | 0.000029 |
| Silicos-it solubility (mol/l) | 7.38E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.92 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.59 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.112 |
| Logd | 3.74 |
| Logp | 4.094 |
| F (20%) | 0.011 |
| F (30%) | 0.877 |
| Mdck | - |
| Ppb | 95.54% |
| Vdss | 2.382 |
| Fu | 2.01% |
| Cyp1a2-inh | 0.326 |
| Cyp1a2-sub | 0.096 |
| Cyp2c19-inh | 0.803 |
| Cyp2c19-sub | 0.109 |
| Cl | 4.703 |
| T12 | 0.04 |
| H-ht | 0.913 |
| Dili | 0.696 |
| Roa | 0.191 |
| Fdamdd | 0.633 |
| Skinsen | 0.172 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.247 |
| Bcf | 1.285 |
| Igc50 | 4.09 |
| Lc50 | 4.984 |
| Lc50dm | 6.288 |
| Nr-ar | 0.043 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.235 |
| Nr-aromatase | 0.828 |
| Nr-er | 0.234 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.557 |
| Sr-are | 0.534 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.443 |
| Sr-mmp | 0.513 |
| Sr-p53 | 0.145 |
| Vol | 405.048 |
| Dense | 0.971 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.731 |
| Synth | 2.244 |
| Fsp3 | 0.348 |
| Mce-18 | 52.516 |
| Natural product-likeness | -1.49 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |