| General Information | |
|---|---|
| ZINC ID | ZINC000103252274 |
| Molecular Weight (Da) | 458 |
| SMILES | O=C(CCc1nc(-c2ccc(F)cc2)no1)Nc1ccc2c(c1)c1ccccc1n2CCCO |
| Molecular Formula | C26F1N4O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.71 |
| HBA | 5 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| LogP | 3.727 |
| Activity (Ki) in nM | 194.984 |
| Polar Surface Area (PSA) | 93.18 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.99285614 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.19 |
| Ilogp | 3.67 |
| Xlogp3 | 4.03 |
| Wlogp | 5.17 |
| Mlogp | 3.05 |
| Silicos-it log p | 4.84 |
| Consensus log p | 4.15 |
| Esol log s | -5.15 |
| Esol solubility (mg/ml) | 3.25E-03 |
| Esol solubility (mol/l) | 7.08E-06 |
| Esol class | Moderately |
| Ali log s | -5.69 |
| Ali solubility (mg/ml) | 9.36E-04 |
| Ali solubility (mol/l) | 2.04E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -9.23 |
| Silicos-it solubility (mg/ml) | 2.69E-07 |
| Silicos-it solubility (mol/l) | 5.86E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.24 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.51 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.053 |
| Logd | 3.683 |
| Logp | 4.4 |
| F (20%) | 0.003 |
| F (30%) | 0.679 |
| Mdck | 1.14E-05 |
| Ppb | 0.9848 |
| Vdss | 1.696 |
| Fu | 0.011 |
| Cyp1a2-inh | 0.942 |
| Cyp1a2-sub | 0.16 |
| Cyp2c19-inh | 0.908 |
| Cyp2c19-sub | 0.06 |
| Cl | 6.326 |
| T12 | 0.099 |
| H-ht | 0.972 |
| Dili | 0.979 |
| Roa | 0.302 |
| Fdamdd | 0.918 |
| Skinsen | 0.096 |
| Ec | 0.003 |
| Ei | 0.026 |
| Respiratory | 0.94 |
| Bcf | 1.554 |
| Igc50 | 4.269 |
| Lc50 | 4.891 |
| Lc50dm | 5.478 |
| Nr-ar | 0.074 |
| Nr-ar-lbd | 0.435 |
| Nr-ahr | 0.962 |
| Nr-aromatase | 0.232 |
| Nr-er | 0.474 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.456 |
| Sr-are | 0.879 |
| Sr-atad5 | 0.202 |
| Sr-hse | 0.032 |
| Sr-mmp | 0.804 |
| Sr-p53 | 0.782 |
| Vol | 460.258 |
| Dense | 0.995 |
| Flex | 27 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 2 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 1 |
| Qed | 2 |
| Synth | 0.344 |
| Fsp3 | 2.31 |
| Mce-18 | 0.192 |
| Natural product-likeness | 26 |
| Alarm nmr | -1.876 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Accepted |
| Goldentriangle | Rejected |