| General Information | |
|---|---|
| ZINC ID | ZINC000140536464 |
| Molecular Weight (Da) | 494 |
| SMILES | Cc1ccc2c(c1)oc1c(C(=O)NC3C4CC5CC(C4)CC3C5)nn(-c3ccc(Cl)cc3Cl)c12 |
| Molecular Formula | C27Cl2N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.53 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| LogP | 7.136 |
| Activity (Ki) in nM | 17.378 |
| Polar Surface Area (PSA) | 60.06 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.93033188 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.41 |
| Ilogp | 4.77 |
| Xlogp3 | 7.34 |
| Wlogp | 6.94 |
| Mlogp | 5.5 |
| Silicos-it log p | 5.52 |
| Consensus log p | 6.01 |
| Esol log s | -7.66 |
| Esol solubility (mg/ml) | 0.0000109 |
| Esol solubility (mol/l) | 0.00000002 |
| Esol class | Poorly sol |
| Ali log s | -8.43 |
| Ali solubility (mg/ml) | 0.00000184 |
| Ali solubility (mol/l) | 3.72E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.56 |
| Silicos-it solubility (mg/ml) | 0.00000137 |
| Silicos-it solubility (mol/l) | 2.78E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.1 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.94 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -8.082 |
| Logd | 5.529 |
| Logp | 6.987 |
| F (20%) | 0 |
| F (30%) | 0.007 |
| Mdck | 9.06E-06 |
| Ppb | 0.9795 |
| Vdss | 2.486 |
| Fu | 0.012 |
| Cyp1a2-inh | 0.116 |
| Cyp1a2-sub | 0.175 |
| Cyp2c19-inh | 0.868 |
| Cyp2c19-sub | 0.232 |
| Cl | 5.28 |
| T12 | 0.014 |
| H-ht | 0.761 |
| Dili | 0.965 |
| Roa | 0.431 |
| Fdamdd | 0.049 |
| Skinsen | 0.025 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.857 |
| Bcf | 2.588 |
| Igc50 | 5.329 |
| Lc50 | 6.514 |
| Lc50dm | 6.326 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.784 |
| Nr-aromatase | 0.931 |
| Nr-er | 0.32 |
| Nr-er-lbd | 0.032 |
| Nr-ppar-gamma | 0.015 |
| Sr-are | 0.792 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.422 |
| Sr-mmp | 0.921 |
| Sr-p53 | 0.904 |
| Vol | 472.918 |
| Dense | 1.043 |
| Flex | 0.121 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 3 |
| Qed | 0.336 |
| Synth | 3.922 |
| Fsp3 | 0.407 |
| Mce-18 | 93.474 |
| Natural product-likeness | -1.056 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |