| General Information | |
|---|---|
| ZINC ID | ZINC000167057004 |
| Molecular Weight (Da) | 377 |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c([C@]2(O)CCC[C@@H](C)C2)c(OC)c1 |
| Molecular Formula | C24O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.923 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| LogP | 6.84 |
| Activity (Ki) in nM | 5011.87 |
| Polar Surface Area (PSA) | 38.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.88712573 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.75 |
| Ilogp | 4.68 |
| Xlogp3 | 7.4 |
| Wlogp | 6.24 |
| Mlogp | 4.25 |
| Silicos-it log p | 6.58 |
| Consensus log p | 5.83 |
| Esol log s | -6.41 |
| Esol solubility (mg/ml) | 0.000147 |
| Esol solubility (mol/l) | 0.00000039 |
| Esol class | Poorly sol |
| Ali log s | -8.04 |
| Ali solubility (mg/ml) | 0.00000341 |
| Ali solubility (mol/l) | 9.06E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.07 |
| Silicos-it solubility (mg/ml) | 0.0000324 |
| Silicos-it solubility (mol/l) | 8.61E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.34 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.05 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.777 |
| Logd | 5.289 |
| Logp | 7.456 |
| F (20%) | 0.982 |
| F (30%) | 0.923 |
| Mdck | - |
| Ppb | 97.25% |
| Vdss | 3.277 |
| Fu | 2.92% |
| Cyp1a2-inh | 0.2 |
| Cyp1a2-sub | 0.926 |
| Cyp2c19-inh | 0.585 |
| Cyp2c19-sub | 0.93 |
| Cl | 8.074 |
| T12 | 0.086 |
| H-ht | 0.185 |
| Dili | 0.069 |
| Roa | 0.074 |
| Fdamdd | 0.921 |
| Skinsen | 0.873 |
| Ec | 0.108 |
| Ei | 0.283 |
| Respiratory | 0.958 |
| Bcf | 2.379 |
| Igc50 | 5.182 |
| Lc50 | 5.848 |
| Lc50dm | 5.982 |
| Nr-ar | 0.533 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.108 |
| Nr-aromatase | 0.8 |
| Nr-er | 0.105 |
| Nr-er-lbd | 0.041 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.333 |
| Sr-atad5 | 0.064 |
| Sr-hse | 0.035 |
| Sr-mmp | 0.655 |
| Sr-p53 | 0.307 |
| Vol | 425.008 |
| Dense | 0.885 |
| Flex | 0.75 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.51 |
| Synth | 3.392 |
| Fsp3 | 0.75 |
| Mce-18 | 55.857 |
| Natural product-likeness | 0.791 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |