| General Information | |
|---|---|
| ZINC ID | ZINC000169346904 |
| Molecular Weight (Da) | 389 |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(=O)OC[C@@H]21 |
| Molecular Formula | C24O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.099 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 5.972 |
| Activity (Ki) in nM | 52.481 |
| Polar Surface Area (PSA) | 55.76 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.832 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.71 |
| Ilogp | 4 |
| Xlogp3 | 7.59 |
| Wlogp | 5.85 |
| Mlogp | 4.12 |
| Silicos-it log p | 5.89 |
| Consensus log p | 5.49 |
| Esol log s | -6.79 |
| Esol solubility (mg/ml) | 0.0000625 |
| Esol solubility (mol/l) | 0.00000016 |
| Esol class | Poorly sol |
| Ali log s | -8.6 |
| Ali solubility (mg/ml) | 0.00000098 |
| Ali solubility (mol/l) | 2.52E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.6 |
| Silicos-it solubility (mg/ml) | 0.0000978 |
| Silicos-it solubility (mol/l) | 0.00000025 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.28 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.902 |
| Logd | 5.435 |
| Logp | 7.602 |
| F (20%) | 0.987 |
| F (30%) | 0.991 |
| Mdck | 1.52E-05 |
| Ppb | 0.9976 |
| Vdss | 3.224 |
| Fu | 0.0277 |
| Cyp1a2-inh | 0.153 |
| Cyp1a2-sub | 0.841 |
| Cyp2c19-inh | 0.704 |
| Cyp2c19-sub | 0.81 |
| Cl | 3.244 |
| T12 | 0.135 |
| H-ht | 0.526 |
| Dili | 0.087 |
| Roa | 0.525 |
| Fdamdd | 0.926 |
| Skinsen | 0.7 |
| Ec | 0.005 |
| Ei | 0.479 |
| Respiratory | 0.915 |
| Bcf | 2.185 |
| Igc50 | 5.349 |
| Lc50 | 6.111 |
| Lc50dm | 6.352 |
| Nr-ar | 0.253 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.212 |
| Nr-aromatase | 0.815 |
| Nr-er | 0.304 |
| Nr-er-lbd | 0.638 |
| Nr-ppar-gamma | 0.58 |
| Sr-are | 0.592 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.122 |
| Sr-mmp | 0.932 |
| Sr-p53 | 0.437 |
| Vol | 422.606 |
| Dense | 0.919 |
| Flex | 0.333 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.491 |
| Synth | 3.687 |
| Fsp3 | 0.708 |
| Mce-18 | 72.439 |
| Natural product-likeness | 1.746 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |