| General Information | |
|---|---|
| ZINC ID | ZINC000205603144 |
| Molecular Weight (Da) | 331 |
| SMILES | CC(C)(C)NC(=O)c1nn(-c2ccc(F)cc2F)c2c1C[C@@H]1C[C@H]21 |
| Molecular Formula | C18F2N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 87.518 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| LogP | 3.515 |
| Activity (Ki) in nM | 7.244 |
| Polar Surface Area (PSA) | 46.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.69475907 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.44 |
| Ilogp | 3.59 |
| Xlogp3 | 3.2 |
| Wlogp | 4.18 |
| Mlogp | 3.76 |
| Silicos-it log p | 3.64 |
| Consensus log p | 3.67 |
| Esol log s | -3.99 |
| Esol solubility (mg/ml) | 0.0343 |
| Esol solubility (mol/l) | 0.000103 |
| Esol class | Soluble |
| Ali log s | -3.86 |
| Ali solubility (mg/ml) | 0.046 |
| Ali solubility (mol/l) | 0.000139 |
| Ali class | Soluble |
| Silicos-it logsw | -5.31 |
| Silicos-it solubility (mg/ml) | 0.00162 |
| Silicos-it solubility (mol/l) | 0.0000049 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.05 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 3.78 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.505 |
| Logd | 4.059 |
| Logp | 4.178 |
| F (20%) | 0.002 |
| F (30%) | 0.003 |
| Mdck | 3.47E-05 |
| Ppb | 0.9438 |
| Vdss | 1.911 |
| Fu | 0.0298 |
| Cyp1a2-inh | 0.55 |
| Cyp1a2-sub | 0.736 |
| Cyp2c19-inh | 0.856 |
| Cyp2c19-sub | 0.907 |
| Cl | 3.094 |
| T12 | 0.093 |
| H-ht | 0.581 |
| Dili | 0.937 |
| Roa | 0.827 |
| Fdamdd | 0.936 |
| Skinsen | 0.235 |
| Ec | 0.004 |
| Ei | 0.021 |
| Respiratory | 0.94 |
| Bcf | 1.536 |
| Igc50 | 2.736 |
| Lc50 | 4.232 |
| Lc50dm | 5.829 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.842 |
| Nr-aromatase | 0.45 |
| Nr-er | 0.286 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.024 |
| Sr-are | 0.572 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.509 |
| Sr-p53 | 0.269 |
| Vol | 323.755 |
| Dense | 1.023 |
| Flex | 0.222 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.917 |
| Synth | 3.385 |
| Fsp3 | 0.444 |
| Mce-18 | 82.692 |
| Natural product-likeness | -1.308 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |