| General Information | |
|---|---|
| ZINC ID | ZINC000211046766 |
| Molecular Weight (Da) | 359 |
| SMILES | CCCOc1c(OC)ccc2cc(C(=O)NC3CCCCC3)c(=O)oc12 |
| Molecular Formula | C20N1O5 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.41 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| LogP | 3.918 |
| Activity (Ki) in nM | 812.831 |
| Polar Surface Area (PSA) | 77.77 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.86647373 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 10 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.21 |
| Xlogp3 | 4.04 |
| Wlogp | 3.65 |
| Mlogp | 2.26 |
| Silicos-it log p | 4.05 |
| Consensus log p | 3.44 |
| Esol log s | -4.44 |
| Esol solubility (mg/ml) | 1.32E-02 |
| Esol solubility (mol/l) | 3.66E-05 |
| Esol class | Moderately |
| Ali log s | -5.38 |
| Ali solubility (mg/ml) | 1.51E-03 |
| Ali solubility (mol/l) | 4.20E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -6.07 |
| Silicos-it solubility (mg/ml) | 3.08E-04 |
| Silicos-it solubility (mol/l) | 8.57E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.62 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.019 |
| Logd | 3.499 |
| Logp | 3.491 |
| F (20%) | 0.004 |
| F (30%) | 0.014 |
| Mdck | 3.06E-05 |
| Ppb | 0.9693 |
| Vdss | 0.559 |
| Fu | 0.0344 |
| Cyp1a2-inh | 0.747 |
| Cyp1a2-sub | 0.673 |
| Cyp2c19-inh | 0.74 |
| Cyp2c19-sub | 0.442 |
| Cl | 3.235 |
| T12 | 0.161 |
| H-ht | 0.882 |
| Dili | 0.942 |
| Roa | 0.229 |
| Fdamdd | 0.282 |
| Skinsen | 0.181 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.06 |
| Bcf | 0.907 |
| Igc50 | 3.754 |
| Lc50 | 4.375 |
| Lc50dm | 4.673 |
| Nr-ar | 0.644 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.778 |
| Nr-aromatase | 0.779 |
| Nr-er | 0.278 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.741 |
| Sr-are | 0.599 |
| Sr-atad5 | 0.383 |
| Sr-hse | 0.026 |
| Sr-mmp | 0.491 |
| Sr-p53 | 0.761 |
| Vol | 367.936 |
| Dense | 0.976 |
| Flex | 19 |
| Nstereo | 0.368 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.797 |
| Fsp3 | 2.259 |
| Mce-18 | 0.5 |
| Natural product-likeness | 40.8 |
| Alarm nmr | -0.463 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Accepted |