| General Information | |
|---|---|
| ZINC ID | ZINC000299821054 |
| Molecular Weight (Da) | 311 |
| SMILES | CC(C)(CO)NC(=O)c1nn(-c2ccccc2)c2c1C[C@H]1C[C@@H]21 |
| Molecular Formula | C18N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 88.629 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| LogP | 2.216 |
| Activity (Ki) in nM | 100 |
| Polar Surface Area (PSA) | 67.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.52883112 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.44 |
| Ilogp | 3.24 |
| Xlogp3 | 1.95 |
| Wlogp | 2.03 |
| Mlogp | 2.16 |
| Silicos-it log p | 2.19 |
| Consensus log p | 2.32 |
| Esol log s | -3.02 |
| Esol solubility (mg/ml) | 2.95E-01 |
| Esol solubility (mol/l) | 9.49E-04 |
| Esol class | Soluble |
| Ali log s | -2.98 |
| Ali solubility (mg/ml) | 3.22E-01 |
| Ali solubility (mol/l) | 1.04E-03 |
| Ali class | Soluble |
| Silicos-it logsw | -4.21 |
| Silicos-it solubility (mg/ml) | 1.94E-02 |
| Silicos-it solubility (mol/l) | 6.24E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.81 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 0 |
| Synthetic accessibility | 3.81 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.328 |
| Logd | 2.421 |
| Logp | 2.398 |
| F (20%) | 0.002 |
| F (30%) | 0.007 |
| Mdck | 1.78E-05 |
| Ppb | 0.8885 |
| Vdss | 0.783 |
| Fu | 0.0752 |
| Cyp1a2-inh | 0.484 |
| Cyp1a2-sub | 0.113 |
| Cyp2c19-inh | 0.276 |
| Cyp2c19-sub | 0.873 |
| Cl | 4.91 |
| T12 | 0.482 |
| H-ht | 0.706 |
| Dili | 0.968 |
| Roa | 0.081 |
| Fdamdd | 0.737 |
| Skinsen | 0.145 |
| Ec | 0.003 |
| Ei | 0.025 |
| Respiratory | 0.824 |
| Bcf | 0.532 |
| Igc50 | 2.424 |
| Lc50 | 3.769 |
| Lc50dm | 3.438 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.752 |
| Nr-aromatase | 0.49 |
| Nr-er | 0.232 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.018 |
| Sr-are | 0.576 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.156 |
| Sr-mmp | 0.424 |
| Sr-p53 | 0.861 |
| Vol | 320.41 |
| Dense | 0.971 |
| Flex | 18 |
| Nstereo | 0.278 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.908 |
| Fsp3 | 3.352 |
| Mce-18 | 0.444 |
| Natural product-likeness | 76.077 |
| Alarm nmr | -0.747 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |