| General Information | |
|---|---|
| ZINC ID | ZINC000299824175 |
| Molecular Weight (Da) | 508 |
| SMILES | Cc1c(C(=O)NCCCCCCCCN)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C25Cl3N4O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 138.084 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| LogP | 7.287 |
| Activity (Ki) in nM | 112.202 |
| Polar Surface Area (PSA) | 72.94 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.12147271 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.36 |
| Ilogp | 4.99 |
| Xlogp3 | 6.98 |
| Wlogp | 6.84 |
| Mlogp | 4.87 |
| Silicos-it log p | 6.98 |
| Consensus log p | 6.13 |
| Esol log s | -6.98 |
| Esol solubility (mg/ml) | 0.0000537 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -8.33 |
| Ali solubility (mg/ml) | 0.0000024 |
| Ali solubility (mol/l) | 4.72E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.37 |
| Silicos-it solubility (mg/ml) | 2.16E-08 |
| Silicos-it solubility (mol/l) | 4.25E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.44 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.448 |
| Logd | 4.156 |
| Logp | 6.552 |
| F (20%) | 0.002 |
| F (30%) | 0.005 |
| Mdck | - |
| Ppb | 98.29% |
| Vdss | 2.988 |
| Fu | 2.49% |
| Cyp1a2-inh | 0.299 |
| Cyp1a2-sub | 0.491 |
| Cyp2c19-inh | 0.915 |
| Cyp2c19-sub | 0.128 |
| Cl | 6.023 |
| T12 | 0.026 |
| H-ht | 0.326 |
| Dili | 0.947 |
| Roa | 0.245 |
| Fdamdd | 0.812 |
| Skinsen | 0.233 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.396 |
| Bcf | 2.713 |
| Igc50 | 5.486 |
| Lc50 | 6.543 |
| Lc50dm | 6.436 |
| Nr-ar | 0.014 |
| Nr-ar-lbd | 0.007 |
| Nr-ahr | 0.902 |
| Nr-aromatase | 0.898 |
| Nr-er | 0.719 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.261 |
| Sr-are | 0.895 |
| Sr-atad5 | 0.361 |
| Sr-hse | 0.425 |
| Sr-mmp | 0.889 |
| Sr-p53 | 0.945 |
| Vol | 489.969 |
| Dense | 1.033 |
| Flex | 0.667 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.279 |
| Synth | 2.371 |
| Fsp3 | 0.36 |
| Mce-18 | 19 |
| Natural product-likeness | -1.052 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |