| General Information | |
|---|---|
| ZINC ID | ZINC000299826806 |
| Molecular Weight (Da) | 436 |
| SMILES | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCC(=O)N[C@H](C)CO)c1 |
| Molecular Formula | C26N1O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.258 |
| HBA | 4 |
| HBD | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| LogP | 6.52 |
| Activity (Ki) in nM | 50.119 |
| Polar Surface Area (PSA) | 78.79 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.824 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.73 |
| Ilogp | 4.76 |
| Xlogp3 | 7.07 |
| Wlogp | 5.86 |
| Mlogp | 3.69 |
| Silicos-it log p | 6.75 |
| Consensus log p | 5.63 |
| Esol log s | -5.95 |
| Esol solubility (mg/ml) | 0.000488 |
| Esol solubility (mol/l) | 0.00000112 |
| Esol class | Moderately |
| Ali log s | -8.54 |
| Ali solubility (mg/ml) | 0.00000125 |
| Ali solubility (mol/l) | 2.87E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.79 |
| Silicos-it solubility (mg/ml) | 0.00000713 |
| Silicos-it solubility (mol/l) | 1.64E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.94 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.05 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.109 |
| Logd | 4.611 |
| Logp | 6.922 |
| F (20%) | 1 |
| F (30%) | 0.995 |
| Mdck | 1.40E-05 |
| Ppb | 0.9864 |
| Vdss | 0.805 |
| Fu | 0.0264 |
| Cyp1a2-inh | 0.242 |
| Cyp1a2-sub | 0.527 |
| Cyp2c19-inh | 0.722 |
| Cyp2c19-sub | 0.116 |
| Cl | 7.072 |
| T12 | 0.23 |
| H-ht | 0.179 |
| Dili | 0.037 |
| Roa | 0.019 |
| Fdamdd | 0.135 |
| Skinsen | 0.927 |
| Ec | 0.003 |
| Ei | 0.031 |
| Respiratory | 0.034 |
| Bcf | 1.124 |
| Igc50 | 5.232 |
| Lc50 | 5.299 |
| Lc50dm | 4.932 |
| Nr-ar | 0.562 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.055 |
| Nr-aromatase | 0.529 |
| Nr-er | 0.383 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.138 |
| Sr-are | 0.523 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.522 |
| Sr-mmp | 0.923 |
| Sr-p53 | 0.223 |
| Vol | 485.307 |
| Dense | 0.897 |
| Flex | 2.571 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.268 |
| Synth | 2.946 |
| Fsp3 | 0.731 |
| Mce-18 | 22 |
| Natural product-likeness | 0.109 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |