| General Information | |
|---|---|
| ZINC ID | ZINC000299829293 |
| Molecular Weight (Da) | 404 |
| SMILES | C=CCNC(=O)CCCCCCCCCCOc1cc(O)cc(CCCCC)c1 |
| Molecular Formula | C25N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.288 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| LogP | 7.297 |
| Activity (Ki) in nM | 16.218 |
| Polar Surface Area (PSA) | 58.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.98356181 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.64 |
| Ilogp | 4.89 |
| Xlogp3 | 7.63 |
| Wlogp | 6.32 |
| Mlogp | 4.23 |
| Silicos-it log p | 7.4 |
| Consensus log p | 6.09 |
| Esol log s | -6.05 |
| Esol solubility (mg/ml) | 0.000361 |
| Esol solubility (mol/l) | 0.00000089 |
| Esol class | Poorly sol |
| Ali log s | -8.7 |
| Ali solubility (mg/ml) | 0.0000008 |
| Ali solubility (mol/l) | 0 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.39 |
| Silicos-it solubility (mg/ml) | 0.00000166 |
| Silicos-it solubility (mol/l) | 4.10E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.34 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4 |
| Logd | 4.436 |
| Logp | 7.154 |
| F (20%) | 0.995 |
| F (30%) | 0.996 |
| Mdck | 1.71E-05 |
| Ppb | 0.9945 |
| Vdss | 0.53 |
| Fu | 0.0073 |
| Cyp1a2-inh | 0.345 |
| Cyp1a2-sub | 0.379 |
| Cyp2c19-inh | 0.796 |
| Cyp2c19-sub | 0.069 |
| Cl | 8.455 |
| T12 | 0.532 |
| H-ht | 0.179 |
| Dili | 0.024 |
| Roa | 0.04 |
| Fdamdd | 0.546 |
| Skinsen | 0.957 |
| Ec | 0.004 |
| Ei | 0.172 |
| Respiratory | 0.37 |
| Bcf | 1.21 |
| Igc50 | 5.372 |
| Lc50 | 4.672 |
| Lc50dm | 5.375 |
| Nr-ar | 0.051 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.778 |
| Nr-aromatase | 0.043 |
| Nr-er | 0.723 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.608 |
| Sr-are | 0.665 |
| Sr-atad5 | 0.334 |
| Sr-hse | 0.594 |
| Sr-mmp | 0.936 |
| Sr-p53 | 0.357 |
| Vol | 456.585 |
| Dense | 0.883 |
| Flex | 2.375 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.223 |
| Synth | 2.323 |
| Fsp3 | 0.64 |
| Mce-18 | 7 |
| Natural product-likeness | -0.024 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |