| General Information | |
|---|---|
| ZINC ID | ZINC000299830755 |
| Molecular Weight (Da) | 500 |
| SMILES | Cc1csc2c1-c1c(c(C(=O)N[C@H]3C(C)(C)[C@H]4CC[C@@]3(C)C4)nn1-c1ccc(Cl)cc1Cl)C2 |
| Molecular Formula | C26Cl2N3O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 134.863 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| LogP | 6.902 |
| Activity (Ki) in nM | 5.248 |
| Polar Surface Area (PSA) | 75.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.997 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.46 |
| Ilogp | 0 |
| Xlogp3 | 7.47 |
| Wlogp | 7.06 |
| Mlogp | 5.47 |
| Silicos-it log p | 7.53 |
| Consensus log p | 5.51 |
| Esol log s | -7.74 |
| Esol solubility (mg/ml) | 0.00000903 |
| Esol solubility (mol/l) | 0.00000001 |
| Esol class | Poorly sol |
| Ali log s | -8.88 |
| Ali solubility (mg/ml) | 0.00000065 |
| Ali solubility (mol/l) | 1.31E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.04 |
| Silicos-it solubility (mg/ml) | 0.00000045 |
| Silicos-it solubility (mol/l) | 9.06E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.05 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.65 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.96 |
| Logd | 5.777 |
| Logp | 7.073 |
| F (20%) | 0.002 |
| F (30%) | 0.033 |
| Mdck | 1.49E-05 |
| Ppb | 0.9968 |
| Vdss | 2.214 |
| Fu | 0.0155 |
| Cyp1a2-inh | 0.12 |
| Cyp1a2-sub | 0.786 |
| Cyp2c19-inh | 0.868 |
| Cyp2c19-sub | 0.859 |
| Cl | 5.802 |
| T12 | 0.018 |
| H-ht | 0.876 |
| Dili | 0.867 |
| Roa | 0.383 |
| Fdamdd | 0.967 |
| Skinsen | 0.072 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.898 |
| Bcf | 2.402 |
| Igc50 | 5.21 |
| Lc50 | 7.066 |
| Lc50dm | 6.589 |
| Nr-ar | 0.012 |
| Nr-ar-lbd | 0.471 |
| Nr-ahr | 0.515 |
| Nr-aromatase | 0.962 |
| Nr-er | 0.81 |
| Nr-er-lbd | 0.69 |
| Nr-ppar-gamma | 0.846 |
| Sr-are | 0.884 |
| Sr-atad5 | 0.033 |
| Sr-hse | 0.794 |
| Sr-mmp | 0.97 |
| Sr-p53 | 0.972 |
| Vol | 476.533 |
| Dense | 1.047 |
| Flex | 0.143 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.327 |
| Synth | 4.781 |
| Fsp3 | 0.462 |
| Mce-18 | 126.579 |
| Natural product-likeness | -0.586 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |