| General Information | |
|---|---|
| ZINC ID | ZINC000299832315 |
| Molecular Weight (Da) | 462 |
| SMILES | Cc1ccc(Cn2nc(C(=O)N[C@H]3C[C@@H](C)CC[C@@H]3C(C)C)c3c2-c2cc(C)sc2C3)cc1 |
| Molecular Formula | C28N3O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 137.273 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 6.532 |
| Activity (Ki) in nM | 4.786 |
| Polar Surface Area (PSA) | 75.16 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.89402973 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.5 |
| Ilogp | 4.57 |
| Xlogp3 | 7.06 |
| Wlogp | 6.37 |
| Mlogp | 4.67 |
| Silicos-it log p | 7.08 |
| Consensus log p | 5.95 |
| Esol log s | -7.11 |
| Esol solubility (mg/ml) | 0.0000356 |
| Esol solubility (mol/l) | 7.71E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.46 |
| Ali solubility (mg/ml) | 0.00000162 |
| Ali solubility (mol/l) | 3.50E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.21 |
| Silicos-it solubility (mg/ml) | 0.00000282 |
| Silicos-it solubility (mol/l) | 6.11E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.1 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.21 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.227 |
| Logd | 5.819 |
| Logp | 6.835 |
| F (20%) | 0.196 |
| F (30%) | 0.075 |
| Mdck | 2.36E-05 |
| Ppb | 1.0012 |
| Vdss | 2.113 |
| Fu | 0.0111 |
| Cyp1a2-inh | 0.074 |
| Cyp1a2-sub | 0.806 |
| Cyp2c19-inh | 0.872 |
| Cyp2c19-sub | 0.783 |
| Cl | 9.254 |
| T12 | 0.01 |
| H-ht | 0.527 |
| Dili | 0.876 |
| Roa | 0.601 |
| Fdamdd | 0.874 |
| Skinsen | 0.037 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.638 |
| Bcf | 1.559 |
| Igc50 | 4.728 |
| Lc50 | 6.286 |
| Lc50dm | 5.235 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.018 |
| Nr-ahr | 0.069 |
| Nr-aromatase | 0.874 |
| Nr-er | 0.712 |
| Nr-er-lbd | 0.573 |
| Nr-ppar-gamma | 0.947 |
| Sr-are | 0.543 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.463 |
| Sr-mmp | 0.855 |
| Sr-p53 | 0.826 |
| Vol | 489.26 |
| Dense | 0.943 |
| Flex | 0.231 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.375 |
| Synth | 3.784 |
| Fsp3 | 0.5 |
| Mce-18 | 96.667 |
| Natural product-likeness | -1.019 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |