| General Information | |
|---|---|
| ZINC ID | ZINC000299858336 |
| Molecular Weight (Da) | 408 |
| SMILES | CC1(C)Oc2cc(C34C[C@H]5C[C@@H](CC(C#N)(C5)C3)C4)cc(O)c2[C@@H]2C[C@H](O)CC[C@H]21 |
| Molecular Formula | C26N1O3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.811 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| LogP | 4.543 |
| Activity (Ki) in nM | 45.7088 |
| Polar Surface Area (PSA) | 73.48 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.787 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.73 |
| Ilogp | 3.34 |
| Xlogp3 | 4.61 |
| Wlogp | 5.17 |
| Mlogp | 3.72 |
| Silicos-it log p | 4.61 |
| Consensus log p | 4.29 |
| Esol log s | -5.35 |
| Esol solubility (mg/ml) | 0.00181 |
| Esol solubility (mol/l) | 0.00000444 |
| Esol class | Moderately |
| Ali log s | -5.88 |
| Ali solubility (mg/ml) | 0.00054 |
| Ali solubility (mol/l) | 0.00000132 |
| Ali class | Moderately |
| Silicos-it logsw | -5.29 |
| Silicos-it solubility (mg/ml) | 0.00211 |
| Silicos-it solubility (mol/l) | 0.00000519 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.51 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 6.05 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.855 |
| Logd | 4.556 |
| Logp | 6.487 |
| F (20%) | 0.005 |
| F (30%) | 0.006 |
| Mdck | - |
| Ppb | 95.69% |
| Vdss | 1.367 |
| Fu | 4.91% |
| Cyp1a2-inh | 0.061 |
| Cyp1a2-sub | 0.647 |
| Cyp2c19-inh | 0.296 |
| Cyp2c19-sub | 0.436 |
| Cl | 1.669 |
| T12 | 0.168 |
| H-ht | 0.943 |
| Dili | 0.048 |
| Roa | 0.636 |
| Fdamdd | 0.98 |
| Skinsen | 0.017 |
| Ec | 0.004 |
| Ei | 0.061 |
| Respiratory | 0.973 |
| Bcf | 2.469 |
| Igc50 | 4.537 |
| Lc50 | 6.353 |
| Lc50dm | 4.533 |
| Nr-ar | 0.16 |
| Nr-ar-lbd | 0.132 |
| Nr-ahr | 0.757 |
| Nr-aromatase | 0.802 |
| Nr-er | 0.32 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.041 |
| Sr-are | 0.534 |
| Sr-atad5 | 0.037 |
| Sr-hse | 0.882 |
| Sr-mmp | 0.932 |
| Sr-p53 | 0.961 |
| Vol | 431.098 |
| Dense | 0.945 |
| Flex | 0.034 |
| Nstereo | 5 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.674 |
| Synth | 5.691 |
| Fsp3 | 0.731 |
| Mce-18 | 135.2 |
| Natural product-likeness | 1.402 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |