| General Information | |
|---|---|
| ZINC ID | ZINC000299861167 |
| Molecular Weight (Da) | 337 |
| SMILES | COc1c(C)cc(-c2ccccc2)cc1C(=O)N[C@@H]1CC[C@H](C)CC1 |
| Molecular Formula | C22N1O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.738 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 5.136 |
| Activity (Ki) in nM | 1096.48 |
| Polar Surface Area (PSA) | 38.33 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.87333226 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.41 |
| Ilogp | 3.91 |
| Xlogp3 | 5.22 |
| Wlogp | 4.98 |
| Mlogp | 3.89 |
| Silicos-it log p | 4.96 |
| Consensus log p | 4.59 |
| Esol log s | -5.25 |
| Esol solubility (mg/ml) | 0.00192 |
| Esol solubility (mol/l) | 0.00000568 |
| Esol class | Moderately |
| Ali log s | -5.77 |
| Ali solubility (mg/ml) | 0.000569 |
| Ali solubility (mol/l) | 0.00000169 |
| Ali class | Moderately |
| Silicos-it logsw | -6.99 |
| Silicos-it solubility (mg/ml) | 0.0000345 |
| Silicos-it solubility (mol/l) | 0.0000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.65 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.28 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.301 |
| Logd | 4.532 |
| Logp | 5.797 |
| F (20%) | 0.039 |
| F (30%) | 0.105 |
| Mdck | - |
| Ppb | 97.98% |
| Vdss | 0.604 |
| Fu | 1.05% |
| Cyp1a2-inh | 0.583 |
| Cyp1a2-sub | 0.681 |
| Cyp2c19-inh | 0.875 |
| Cyp2c19-sub | 0.275 |
| Cl | 4.895 |
| T12 | 0.052 |
| H-ht | 0.414 |
| Dili | 0.211 |
| Roa | 0.063 |
| Fdamdd | 0.278 |
| Skinsen | 0.758 |
| Ec | 0.003 |
| Ei | 0.018 |
| Respiratory | 0.348 |
| Bcf | 1.401 |
| Igc50 | 4.404 |
| Lc50 | 5.026 |
| Lc50dm | 5.597 |
| Nr-ar | 0.718 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.425 |
| Nr-aromatase | 0.094 |
| Nr-er | 0.293 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.211 |
| Sr-are | 0.202 |
| Sr-atad5 | 0.026 |
| Sr-hse | 0.174 |
| Sr-mmp | 0.496 |
| Sr-p53 | 0.285 |
| Vol | 373.521 |
| Dense | 0.903 |
| Flex | 0.263 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.854 |
| Synth | 2.003 |
| Fsp3 | 0.409 |
| Mce-18 | 40.581 |
| Natural product-likeness | -0.688 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |